Updating to 1.13 alpha1
This commit is contained in:
parent
c48fd0f0bc
commit
8563ebea46
3
.gitignore
vendored
3
.gitignore
vendored
@ -110,3 +110,6 @@ krb5-1.8.3-pdf.tar.gz
|
||||
/krb5-1.12.2.tar.gz
|
||||
/krb5-1.12.2.tar.gz.asc
|
||||
/krb5-1.12.2-pdf.tar.xz
|
||||
/krb5-1.13-alpha1.tar.gz
|
||||
/krb5-1.13-alpha1.tar.gz.asc
|
||||
/krb5-1.13-alpha1-pdf.tar.xz
|
||||
|
||||
@ -1,230 +0,0 @@
|
||||
From 74e775ac6d937c9d22be4fc1d429e5e62705fb7d Mon Sep 17 00:00:00 2001
|
||||
From: Nalin Dahyabhai <nalin@redhat.com>
|
||||
Date: Thu, 24 Jul 2014 15:39:53 -0400
|
||||
Subject: [PATCH 1/7] In ksu, merge krb5_ccache_copy() and _restricted()
|
||||
|
||||
Other than whether or not they limit the creds it stores to the new
|
||||
ccache based on the principal name of the client for whom the creds were
|
||||
issued, there's no meaningful difference between what these two
|
||||
functions do. Merge them.
|
||||
---
|
||||
src/clients/ksu/ccache.c | 106 ++++++-----------------------------------------
|
||||
src/clients/ksu/ksu.h | 6 +--
|
||||
src/clients/ksu/main.c | 27 ++++--------
|
||||
3 files changed, 22 insertions(+), 117 deletions(-)
|
||||
|
||||
diff --git a/src/clients/ksu/ccache.c b/src/clients/ksu/ccache.c
|
||||
index 9916c75..118fc53 100644
|
||||
--- a/src/clients/ksu/ccache.c
|
||||
+++ b/src/clients/ksu/ccache.c
|
||||
@@ -47,12 +47,14 @@ void show_credential();
|
||||
*/
|
||||
|
||||
krb5_error_code krb5_ccache_copy (context, cc_def, cc_other_tag,
|
||||
- primary_principal, cc_out, stored, target_uid)
|
||||
+ primary_principal, restrict_creds, cc_out,
|
||||
+ stored, target_uid)
|
||||
/* IN */
|
||||
krb5_context context;
|
||||
krb5_ccache cc_def;
|
||||
char *cc_other_tag;
|
||||
krb5_principal primary_principal;
|
||||
+ krb5_boolean restrict_creds;
|
||||
uid_t target_uid;
|
||||
/* OUT */
|
||||
krb5_ccache *cc_out;
|
||||
@@ -83,9 +85,6 @@ krb5_error_code krb5_ccache_copy (context, cc_def, cc_other_tag,
|
||||
}
|
||||
}
|
||||
|
||||
- *stored = krb5_find_princ_in_cred_list(context, cc_def_creds_arr,
|
||||
- primary_principal);
|
||||
-
|
||||
if (!lstat( cc_other_name, &st_temp))
|
||||
return EINVAL;
|
||||
|
||||
@@ -98,8 +97,16 @@ krb5_error_code krb5_ccache_copy (context, cc_def, cc_other_tag,
|
||||
return retval;
|
||||
}
|
||||
|
||||
- retval = krb5_store_all_creds(context, * cc_other, cc_def_creds_arr,
|
||||
- cc_other_creds_arr);
|
||||
+ if (restrict_creds) {
|
||||
+ retval = krb5_store_some_creds(context, *cc_other, cc_def_creds_arr,
|
||||
+ cc_other_creds_arr, primary_principal,
|
||||
+ stored);
|
||||
+ } else {
|
||||
+ *stored = krb5_find_princ_in_cred_list(context, cc_def_creds_arr,
|
||||
+ primary_principal);
|
||||
+ retval = krb5_store_all_creds(context, *cc_other, cc_def_creds_arr,
|
||||
+ cc_other_creds_arr);
|
||||
+ }
|
||||
|
||||
if (cc_def_creds_arr){
|
||||
while (cc_def_creds_arr[i]){
|
||||
@@ -623,93 +630,6 @@ krb5_error_code krb5_store_some_creds(context, cc, creds_def, creds_other, prst,
|
||||
*stored = temp_stored;
|
||||
return 0;
|
||||
}
|
||||
-/******************************************************************
|
||||
-krb5_cache_copy_restricted
|
||||
-
|
||||
-gets rid of any expired tickets in the secondary cache,
|
||||
-copies the default cache into the secondary cache,
|
||||
-only credentials that are for prst are copied.
|
||||
-
|
||||
-the algorithm may look a bit funny,
|
||||
-but I had to do it this way, since cc_remove function did not come
|
||||
-with k5 beta 3 release.
|
||||
-************************************************************************/
|
||||
-
|
||||
-krb5_error_code krb5_ccache_copy_restricted (context, cc_def, cc_other_tag,
|
||||
- prst, cc_out, stored, target_uid)
|
||||
- krb5_context context;
|
||||
- krb5_ccache cc_def;
|
||||
- char *cc_other_tag;
|
||||
- krb5_principal prst;
|
||||
- uid_t target_uid;
|
||||
- /* OUT */
|
||||
- krb5_ccache *cc_out;
|
||||
- krb5_boolean *stored;
|
||||
-{
|
||||
-
|
||||
- int i=0;
|
||||
- krb5_ccache * cc_other;
|
||||
- const char * cc_def_name;
|
||||
- const char * cc_other_name;
|
||||
- krb5_error_code retval=0;
|
||||
- krb5_creds ** cc_def_creds_arr = NULL;
|
||||
- krb5_creds ** cc_other_creds_arr = NULL;
|
||||
- struct stat st_temp;
|
||||
-
|
||||
- cc_other = (krb5_ccache *) xcalloc(1, sizeof (krb5_ccache));
|
||||
-
|
||||
- if ((retval = krb5_cc_resolve(context, cc_other_tag, cc_other))){
|
||||
- com_err(prog_name, retval, _("resolving ccache %s"), cc_other_tag);
|
||||
- return retval;
|
||||
- }
|
||||
-
|
||||
- cc_def_name = krb5_cc_get_name(context, cc_def);
|
||||
- cc_other_name = krb5_cc_get_name(context, *cc_other);
|
||||
-
|
||||
- if ( ! stat(cc_def_name, &st_temp)){
|
||||
- if((retval = krb5_get_nonexp_tkts(context,cc_def,&cc_def_creds_arr))){
|
||||
- return retval;
|
||||
- }
|
||||
-
|
||||
- }
|
||||
-
|
||||
- if (!lstat( cc_other_name, &st_temp)) {
|
||||
- return EINVAL;
|
||||
- }
|
||||
-
|
||||
- if (krb5_seteuid(0)||krb5_seteuid(target_uid)) {
|
||||
- return errno;
|
||||
- }
|
||||
-
|
||||
-
|
||||
- if ((retval = krb5_cc_initialize(context, *cc_other, prst))){
|
||||
- return retval;
|
||||
- }
|
||||
-
|
||||
- retval = krb5_store_some_creds(context, * cc_other,
|
||||
- cc_def_creds_arr, cc_other_creds_arr, prst, stored);
|
||||
-
|
||||
-
|
||||
-
|
||||
- if (cc_def_creds_arr){
|
||||
- while (cc_def_creds_arr[i]){
|
||||
- krb5_free_creds(context, cc_def_creds_arr[i]);
|
||||
- i++;
|
||||
- }
|
||||
- }
|
||||
-
|
||||
- i=0;
|
||||
-
|
||||
- if(cc_other_creds_arr){
|
||||
- while (cc_other_creds_arr[i]){
|
||||
- krb5_free_creds(context, cc_other_creds_arr[i]);
|
||||
- i++;
|
||||
- }
|
||||
- }
|
||||
-
|
||||
- *cc_out = *cc_other;
|
||||
- return retval;
|
||||
-}
|
||||
|
||||
krb5_error_code krb5_ccache_filter (context, cc, prst)
|
||||
krb5_context context;
|
||||
diff --git a/src/clients/ksu/ksu.h b/src/clients/ksu/ksu.h
|
||||
index f2c0811..9e0c613 100644
|
||||
--- a/src/clients/ksu/ksu.h
|
||||
+++ b/src/clients/ksu/ksu.h
|
||||
@@ -107,7 +107,7 @@ extern krb5_error_code get_best_principal
|
||||
/* ccache.c */
|
||||
extern krb5_error_code krb5_ccache_copy
|
||||
(krb5_context, krb5_ccache, char *, krb5_principal,
|
||||
- krb5_ccache *, krb5_boolean *, uid_t);
|
||||
+ krb5_boolean, krb5_ccache *, krb5_boolean *, uid_t);
|
||||
|
||||
extern krb5_error_code krb5_store_all_creds
|
||||
(krb5_context, krb5_ccache, krb5_creds **, krb5_creds **);
|
||||
@@ -141,10 +141,6 @@ extern krb5_error_code krb5_store_some_creds
|
||||
(krb5_context, krb5_ccache, krb5_creds **, krb5_creds **,
|
||||
krb5_principal, krb5_boolean *);
|
||||
|
||||
-extern krb5_error_code krb5_ccache_copy_restricted
|
||||
-(krb5_context, krb5_ccache, char *, krb5_principal,
|
||||
- krb5_ccache *, krb5_boolean *, uid_t);
|
||||
-
|
||||
extern krb5_error_code krb5_ccache_refresh
|
||||
(krb5_context, krb5_ccache);
|
||||
|
||||
diff --git a/src/clients/ksu/main.c b/src/clients/ksu/main.c
|
||||
index 233eb52..62f3bc0 100644
|
||||
--- a/src/clients/ksu/main.c
|
||||
+++ b/src/clients/ksu/main.c
|
||||
@@ -117,6 +117,7 @@ main (argc, argv)
|
||||
krb5_principal kdc_server;
|
||||
krb5_boolean zero_password;
|
||||
char * dir_of_cc_target;
|
||||
+ krb5_boolean restrict_creds;
|
||||
|
||||
options.opt = KRB5_DEFAULT_OPTIONS;
|
||||
options.lifetime = KRB5_DEFAULT_TKT_LIFE;
|
||||
@@ -464,25 +465,13 @@ main (argc, argv)
|
||||
then only the credentials for that particular user
|
||||
should be copied */
|
||||
|
||||
- if ((source_uid == 0) && (target_uid != 0)) {
|
||||
-
|
||||
- if ((retval = krb5_ccache_copy_restricted(ksu_context, cc_source,
|
||||
- cc_target_tag, client,
|
||||
- &cc_target, &stored,
|
||||
- target_uid))){
|
||||
- com_err(prog_name, retval, _("while copying cache %s to %s"),
|
||||
- krb5_cc_get_name(ksu_context, cc_source), cc_target_tag);
|
||||
- exit(1);
|
||||
- }
|
||||
-
|
||||
- } else {
|
||||
- if ((retval = krb5_ccache_copy(ksu_context, cc_source, cc_target_tag,
|
||||
- client,&cc_target, &stored, target_uid))) {
|
||||
- com_err(prog_name, retval, _("while copying cache %s to %s"),
|
||||
- krb5_cc_get_name(ksu_context, cc_source), cc_target_tag);
|
||||
- exit(1);
|
||||
- }
|
||||
-
|
||||
+ restrict_creds = (source_uid == 0) && (target_uid != 0);
|
||||
+ retval = krb5_ccache_copy(ksu_context, cc_source, cc_target_tag, client,
|
||||
+ restrict_creds, &cc_target, &stored, target_uid);
|
||||
+ if (retval) {
|
||||
+ com_err(prog_name, retval, _("while copying cache %s to %s"),
|
||||
+ krb5_cc_get_name(ksu_context, cc_source), cc_target_tag);
|
||||
+ exit(1);
|
||||
}
|
||||
|
||||
/* Become root for authentication*/
|
||||
--
|
||||
2.0.4
|
||||
|
||||
@ -1,369 +0,0 @@
|
||||
From 9ebae7cb434b9b177c0af85c67a6d6267f46bc68 Mon Sep 17 00:00:00 2001
|
||||
From: Nalin Dahyabhai <nalin@redhat.com>
|
||||
Date: Fri, 1 Nov 2013 09:48:13 -0400
|
||||
Subject: [PATCH 2/7] In ksu, don't stat() not-on-disk ccache residuals
|
||||
|
||||
Don't assume that ccache residual names are filenames which we can
|
||||
stat() usefully. Instead, use helper functions to call the library
|
||||
routines to try to read the default principal name from caches, and
|
||||
use whether or not that succeeds as an indication of whether or not
|
||||
there's a ccache in a given location.
|
||||
|
||||
ticket: 7728
|
||||
---
|
||||
src/clients/ksu/ccache.c | 60 ++++++++++++++++++++--------------
|
||||
src/clients/ksu/heuristic.c | 13 ++------
|
||||
src/clients/ksu/ksu.h | 8 +++--
|
||||
src/clients/ksu/main.c | 79 +++++++++------------------------------------
|
||||
4 files changed, 60 insertions(+), 100 deletions(-)
|
||||
|
||||
diff --git a/src/clients/ksu/ccache.c b/src/clients/ksu/ccache.c
|
||||
index 118fc53..5f57279 100644
|
||||
--- a/src/clients/ksu/ccache.c
|
||||
+++ b/src/clients/ksu/ccache.c
|
||||
@@ -62,12 +62,9 @@ krb5_error_code krb5_ccache_copy (context, cc_def, cc_other_tag,
|
||||
{
|
||||
int i=0;
|
||||
krb5_ccache * cc_other;
|
||||
- const char * cc_def_name;
|
||||
- const char * cc_other_name;
|
||||
krb5_error_code retval=0;
|
||||
krb5_creds ** cc_def_creds_arr = NULL;
|
||||
krb5_creds ** cc_other_creds_arr = NULL;
|
||||
- struct stat st_temp;
|
||||
|
||||
cc_other = (krb5_ccache *) xcalloc(1, sizeof (krb5_ccache));
|
||||
|
||||
@@ -76,16 +73,13 @@ krb5_error_code krb5_ccache_copy (context, cc_def, cc_other_tag,
|
||||
return retval;
|
||||
}
|
||||
|
||||
- cc_def_name = krb5_cc_get_name(context, cc_def);
|
||||
- cc_other_name = krb5_cc_get_name(context, *cc_other);
|
||||
-
|
||||
- if ( ! stat(cc_def_name, &st_temp)){
|
||||
+ if (ks_ccache_is_initialized(context, cc_def)) {
|
||||
if((retval = krb5_get_nonexp_tkts(context,cc_def,&cc_def_creds_arr))){
|
||||
return retval;
|
||||
}
|
||||
}
|
||||
|
||||
- if (!lstat( cc_other_name, &st_temp))
|
||||
+ if (ks_ccache_name_is_initialized(context, cc_other_tag))
|
||||
return EINVAL;
|
||||
|
||||
if (krb5_seteuid(0)||krb5_seteuid(target_uid)) {
|
||||
@@ -540,24 +534,18 @@ krb5_error_code krb5_ccache_overwrite(context, ccs, cct, primary_principal)
|
||||
krb5_ccache cct;
|
||||
krb5_principal primary_principal;
|
||||
{
|
||||
- const char * cct_name;
|
||||
- const char * ccs_name;
|
||||
krb5_error_code retval=0;
|
||||
krb5_principal temp_principal;
|
||||
krb5_creds ** ccs_creds_arr = NULL;
|
||||
int i=0;
|
||||
- struct stat st_temp;
|
||||
|
||||
- ccs_name = krb5_cc_get_name(context, ccs);
|
||||
- cct_name = krb5_cc_get_name(context, cct);
|
||||
-
|
||||
- if ( ! stat(ccs_name, &st_temp)){
|
||||
+ if (ks_ccache_is_initialized(context, ccs)) {
|
||||
if ((retval = krb5_get_nonexp_tkts(context, ccs, &ccs_creds_arr))){
|
||||
return retval;
|
||||
}
|
||||
}
|
||||
|
||||
- if ( ! stat(cct_name, &st_temp)){
|
||||
+ if (ks_ccache_is_initialized(context, cct)) {
|
||||
if ((retval = krb5_cc_get_principal(context, cct, &temp_principal))){
|
||||
return retval;
|
||||
}
|
||||
@@ -643,12 +631,10 @@ krb5_error_code krb5_ccache_filter (context, cc, prst)
|
||||
krb5_creds ** cc_creds_arr = NULL;
|
||||
const char * cc_name;
|
||||
krb5_boolean stored;
|
||||
- struct stat st_temp;
|
||||
|
||||
cc_name = krb5_cc_get_name(context, cc);
|
||||
|
||||
- if ( ! stat(cc_name, &st_temp)){
|
||||
-
|
||||
+ if (ks_ccache_is_initialized(context, cc)) {
|
||||
if (auth_debug) {
|
||||
fprintf(stderr,"putting cache %s through a filter for -z option\n", cc_name);
|
||||
}
|
||||
@@ -713,12 +699,8 @@ krb5_error_code krb5_find_princ_in_cache (context, cc, princ, found)
|
||||
{
|
||||
krb5_error_code retval;
|
||||
krb5_creds ** creds_list = NULL;
|
||||
- const char * cc_name;
|
||||
- struct stat st_temp;
|
||||
-
|
||||
- cc_name = krb5_cc_get_name(context, cc);
|
||||
|
||||
- if ( ! stat(cc_name, &st_temp)){
|
||||
+ if (ks_ccache_is_initialized(context, cc)) {
|
||||
if ((retval = krb5_get_nonexp_tkts(context, cc, &creds_list))){
|
||||
return retval;
|
||||
}
|
||||
@@ -727,3 +709,33 @@ krb5_error_code krb5_find_princ_in_cache (context, cc, princ, found)
|
||||
*found = krb5_find_princ_in_cred_list(context, creds_list, princ);
|
||||
return 0;
|
||||
}
|
||||
+
|
||||
+krb5_boolean
|
||||
+ks_ccache_name_is_initialized(krb5_context context, const char *cctag)
|
||||
+{
|
||||
+ krb5_boolean result;
|
||||
+ krb5_ccache cc;
|
||||
+
|
||||
+ if (krb5_cc_resolve(context, cctag, &cc) != 0)
|
||||
+ return FALSE;
|
||||
+ result = ks_ccache_is_initialized(context, cc);
|
||||
+ krb5_cc_close(context, cc);
|
||||
+
|
||||
+ return result;
|
||||
+}
|
||||
+
|
||||
+krb5_boolean
|
||||
+ks_ccache_is_initialized(krb5_context context, krb5_ccache cc)
|
||||
+{
|
||||
+ krb5_principal princ;
|
||||
+ krb5_error_code retval;
|
||||
+
|
||||
+ if (cc == NULL)
|
||||
+ return FALSE;
|
||||
+
|
||||
+ retval = krb5_cc_get_principal(context, cc, &princ);
|
||||
+ if (retval == 0)
|
||||
+ krb5_free_principal(context, princ);
|
||||
+
|
||||
+ return retval == 0;
|
||||
+}
|
||||
diff --git a/src/clients/ksu/heuristic.c b/src/clients/ksu/heuristic.c
|
||||
index 99b54e5..f73b8eb 100644
|
||||
--- a/src/clients/ksu/heuristic.c
|
||||
+++ b/src/clients/ksu/heuristic.c
|
||||
@@ -397,12 +397,8 @@ krb5_error_code find_either_ticket (context, cc, client, end_server, found)
|
||||
krb5_principal kdc_server;
|
||||
krb5_error_code retval;
|
||||
krb5_boolean temp_found = FALSE;
|
||||
- const char * cc_source_name;
|
||||
- struct stat st_temp;
|
||||
|
||||
- cc_source_name = krb5_cc_get_name(context, cc);
|
||||
-
|
||||
- if ( ! stat(cc_source_name, &st_temp)){
|
||||
+ if (ks_ccache_is_initialized(context, cc)) {
|
||||
|
||||
retval = find_ticket(context, cc, client, end_server, &temp_found);
|
||||
if (retval)
|
||||
@@ -539,7 +535,6 @@ krb5_error_code get_best_princ_for_target(context, source_uid, target_uid,
|
||||
{
|
||||
|
||||
princ_info princ_trials[10];
|
||||
- const char * cc_source_name;
|
||||
krb5_principal cc_def_princ = NULL;
|
||||
krb5_principal temp_client;
|
||||
krb5_principal target_client;
|
||||
@@ -551,7 +546,6 @@ krb5_error_code get_best_princ_for_target(context, source_uid, target_uid,
|
||||
struct stat tb;
|
||||
int count =0;
|
||||
int i;
|
||||
- struct stat st_temp;
|
||||
|
||||
*path_out = 0;
|
||||
|
||||
@@ -559,10 +553,7 @@ krb5_error_code get_best_princ_for_target(context, source_uid, target_uid,
|
||||
if (options->princ)
|
||||
return 0;
|
||||
|
||||
- cc_source_name = krb5_cc_get_name(context, cc_source);
|
||||
-
|
||||
-
|
||||
- if (! stat(cc_source_name, &st_temp)) {
|
||||
+ if (ks_ccache_is_initialized(context, cc_source)) {
|
||||
retval = krb5_cc_get_principal(context, cc_source, &cc_def_princ);
|
||||
if (retval)
|
||||
return retval;
|
||||
diff --git a/src/clients/ksu/ksu.h b/src/clients/ksu/ksu.h
|
||||
index 9e0c613..e1e34f1 100644
|
||||
--- a/src/clients/ksu/ksu.h
|
||||
+++ b/src/clients/ksu/ksu.h
|
||||
@@ -141,6 +141,12 @@ extern krb5_error_code krb5_store_some_creds
|
||||
(krb5_context, krb5_ccache, krb5_creds **, krb5_creds **,
|
||||
krb5_principal, krb5_boolean *);
|
||||
|
||||
+extern krb5_boolean ks_ccache_name_is_initialized
|
||||
+(krb5_context, const char *);
|
||||
+
|
||||
+extern krb5_boolean ks_ccache_is_initialized
|
||||
+(krb5_context, krb5_ccache);
|
||||
+
|
||||
extern krb5_error_code krb5_ccache_refresh
|
||||
(krb5_context, krb5_ccache);
|
||||
|
||||
@@ -198,8 +204,6 @@ extern int standard_shell (char *);
|
||||
|
||||
extern krb5_error_code get_params (int *, int, char **, char ***);
|
||||
|
||||
-extern char *get_dir_of_file (const char *);
|
||||
-
|
||||
/* heuristic.c */
|
||||
extern krb5_error_code get_all_princ_from_file (FILE *, char ***);
|
||||
|
||||
diff --git a/src/clients/ksu/main.c b/src/clients/ksu/main.c
|
||||
index 62f3bc0..8c49f94 100644
|
||||
--- a/src/clients/ksu/main.c
|
||||
+++ b/src/clients/ksu/main.c
|
||||
@@ -51,7 +51,6 @@ static void print_status( const char *fmt, ...)
|
||||
__attribute__ ((__format__ (__printf__, 1, 2)))
|
||||
#endif
|
||||
;
|
||||
-char * get_dir_of_file();
|
||||
|
||||
/* Note -e and -a options are mutually exclusive */
|
||||
/* insure the proper specification of target user as well as catching
|
||||
@@ -96,7 +95,6 @@ main (argc, argv)
|
||||
const char * cc_source_tag = NULL;
|
||||
uid_t source_gid;
|
||||
const char * cc_source_tag_tmp = NULL;
|
||||
- char * cc_target_tag_tmp=NULL;
|
||||
char * cmd = NULL, * exec_cmd = NULL;
|
||||
int errflg = 0;
|
||||
krb5_boolean auth_val;
|
||||
@@ -112,11 +110,9 @@ main (argc, argv)
|
||||
extern char * getpass(), *crypt();
|
||||
int pargc;
|
||||
char ** pargv;
|
||||
- struct stat st_temp;
|
||||
krb5_boolean stored = FALSE;
|
||||
krb5_principal kdc_server;
|
||||
krb5_boolean zero_password;
|
||||
- char * dir_of_cc_target;
|
||||
krb5_boolean restrict_creds;
|
||||
|
||||
options.opt = KRB5_DEFAULT_OPTIONS;
|
||||
@@ -266,9 +262,10 @@ main (argc, argv)
|
||||
if ( strchr(cc_source_tag, ':')){
|
||||
cc_source_tag_tmp = strchr(cc_source_tag, ':') + 1;
|
||||
|
||||
- if( stat( cc_source_tag_tmp, &st_temp)){
|
||||
+ if (!ks_ccache_name_is_initialized(ksu_context,
|
||||
+ cc_source_tag)) {
|
||||
com_err(prog_name, errno,
|
||||
- _("while looking for credentials file %s"),
|
||||
+ _("while looking for credentials cache %s"),
|
||||
cc_source_tag_tmp);
|
||||
exit (1);
|
||||
}
|
||||
@@ -419,32 +416,18 @@ main (argc, argv)
|
||||
exit(1);
|
||||
}
|
||||
|
||||
- if (cc_target_tag == NULL) {
|
||||
-
|
||||
- cc_target_tag = (char *)xcalloc(KRB5_SEC_BUFFSIZE ,sizeof(char));
|
||||
- /* make sure that the new ticket file does not already exist
|
||||
- This is run as source_uid because it is reasonable to
|
||||
- require the source user to have write to where the target
|
||||
- cache will be created.*/
|
||||
-
|
||||
- do {
|
||||
- snprintf(cc_target_tag, KRB5_SEC_BUFFSIZE, "%s%ld.%d",
|
||||
- KRB5_SECONDARY_CACHE,
|
||||
- (long) target_uid, gen_sym());
|
||||
- cc_target_tag_tmp = strchr(cc_target_tag, ':') + 1;
|
||||
-
|
||||
- }while ( !stat ( cc_target_tag_tmp, &st_temp));
|
||||
- }
|
||||
-
|
||||
-
|
||||
- dir_of_cc_target = get_dir_of_file(cc_target_tag_tmp);
|
||||
-
|
||||
- if (access(dir_of_cc_target, R_OK | W_OK )){
|
||||
- fprintf(stderr,
|
||||
- _("%s does not have correct permissions for %s\n"),
|
||||
- source_user, cc_target_tag);
|
||||
- exit(1);
|
||||
- }
|
||||
+ /*
|
||||
+ * Make sure that the new ticket file does not already exist.
|
||||
+ * This is run as source_uid because it is reasonable to
|
||||
+ * require the source user to have write to where the target
|
||||
+ * cache will be created.
|
||||
+ */
|
||||
+ cc_target_tag = (char *)xcalloc(KRB5_SEC_BUFFSIZE, sizeof(char));
|
||||
+ do {
|
||||
+ snprintf(cc_target_tag, KRB5_SEC_BUFFSIZE, "%s%ld.%d",
|
||||
+ KRB5_SECONDARY_CACHE,
|
||||
+ (long)target_uid, gen_sym());
|
||||
+ } while (ks_ccache_name_is_initialized(ksu_context, cc_target_tag));
|
||||
|
||||
if (auth_debug){
|
||||
fprintf(stderr, " source cache = %s\n", cc_source_tag);
|
||||
@@ -747,13 +730,6 @@ main (argc, argv)
|
||||
exit(1);
|
||||
}
|
||||
|
||||
- if (access( cc_target_tag_tmp, R_OK | W_OK )){
|
||||
- com_err(prog_name, errno,
|
||||
- _("%s does not have correct permissions for %s, %s aborted"),
|
||||
- target_user, cc_target_tag_tmp, prog_name);
|
||||
- exit(1);
|
||||
- }
|
||||
-
|
||||
if ( cc_source)
|
||||
krb5_cc_close(ksu_context, cc_source);
|
||||
|
||||
@@ -873,8 +849,6 @@ static void sweep_up(context, cc)
|
||||
krb5_ccache cc;
|
||||
{
|
||||
krb5_error_code retval;
|
||||
- const char * cc_name;
|
||||
- struct stat st_temp;
|
||||
|
||||
krb5_seteuid(0);
|
||||
if (krb5_seteuid(target_uid) < 0) {
|
||||
@@ -883,8 +857,7 @@ static void sweep_up(context, cc)
|
||||
exit(1);
|
||||
}
|
||||
|
||||
- cc_name = krb5_cc_get_name(context, cc);
|
||||
- if ( ! stat(cc_name, &st_temp)){
|
||||
+ if (ks_ccache_is_initialized(context, cc)) {
|
||||
if ((retval = krb5_cc_destroy(context, cc)))
|
||||
com_err(prog_name, retval, _("while destroying cache"));
|
||||
}
|
||||
@@ -937,26 +910,6 @@ void print_status(const char *fmt, ...)
|
||||
}
|
||||
}
|
||||
|
||||
-
|
||||
-char *get_dir_of_file(path)
|
||||
- const char *path;
|
||||
-{
|
||||
- char * temp_path;
|
||||
- char * ptr;
|
||||
-
|
||||
- temp_path = xstrdup(path);
|
||||
-
|
||||
- if ((ptr = strrchr( temp_path, '/'))) {
|
||||
- *ptr = '\0';
|
||||
- } else {
|
||||
- free (temp_path);
|
||||
- temp_path = xmalloc(MAXPATHLEN);
|
||||
- if (temp_path)
|
||||
- getcwd(temp_path, MAXPATHLEN);
|
||||
- }
|
||||
- return temp_path;
|
||||
-}
|
||||
-
|
||||
krb5_error_code
|
||||
ksu_tgtname(context, server, client, tgtprinc)
|
||||
krb5_context context;
|
||||
--
|
||||
2.0.4
|
||||
|
||||
@ -1,417 +0,0 @@
|
||||
From dccc80a469b1925fcfe7697406a69912efe4baa1 Mon Sep 17 00:00:00 2001
|
||||
From: Nalin Dahyabhai <nalin@dahyabhai.net>
|
||||
Date: Wed, 30 Oct 2013 21:45:35 -0400
|
||||
Subject: [PATCH 3/7] Use an intermediate memory cache in ksu
|
||||
|
||||
Instead of copying source or obtained creds into the target cache and
|
||||
changing ownership if everything succeeds, copy them into a MEMORY:
|
||||
cache and then, if everything succeeds, create the target cache as the
|
||||
target user.
|
||||
|
||||
We no longer need to clean up the temporary ccache when exiting in
|
||||
most error cases.
|
||||
|
||||
Use a fake principal name ("_ksu/_ksu@_ksu") as the primary holder of
|
||||
the temporary cache so that we won't accidentally select it when we
|
||||
make a subsequent call to krb5_cc_cache_match() (to be added in a
|
||||
later patch) to find the target location where the creds should be
|
||||
stored for use while running as the target user.
|
||||
---
|
||||
src/clients/ksu/ccache.c | 10 +--
|
||||
src/clients/ksu/ksu.h | 4 +-
|
||||
src/clients/ksu/main.c | 156 ++++++++++++++++++++++++-----------------------
|
||||
3 files changed, 87 insertions(+), 83 deletions(-)
|
||||
|
||||
diff --git a/src/clients/ksu/ccache.c b/src/clients/ksu/ccache.c
|
||||
index 5f57279..d0fc389 100644
|
||||
--- a/src/clients/ksu/ccache.c
|
||||
+++ b/src/clients/ksu/ccache.c
|
||||
@@ -47,14 +47,15 @@ void show_credential();
|
||||
*/
|
||||
|
||||
krb5_error_code krb5_ccache_copy (context, cc_def, cc_other_tag,
|
||||
- primary_principal, restrict_creds, cc_out,
|
||||
- stored, target_uid)
|
||||
+ primary_principal, restrict_creds,
|
||||
+ target_principal, cc_out, stored, target_uid)
|
||||
/* IN */
|
||||
krb5_context context;
|
||||
krb5_ccache cc_def;
|
||||
char *cc_other_tag;
|
||||
krb5_principal primary_principal;
|
||||
krb5_boolean restrict_creds;
|
||||
+ krb5_principal target_principal;
|
||||
uid_t target_uid;
|
||||
/* OUT */
|
||||
krb5_ccache *cc_out;
|
||||
@@ -86,10 +87,9 @@ krb5_error_code krb5_ccache_copy (context, cc_def, cc_other_tag,
|
||||
return errno;
|
||||
}
|
||||
|
||||
-
|
||||
- if ((retval = krb5_cc_initialize(context, *cc_other, primary_principal))){
|
||||
+ retval = krb5_cc_initialize(context, *cc_other, target_principal);
|
||||
+ if (retval)
|
||||
return retval;
|
||||
- }
|
||||
|
||||
if (restrict_creds) {
|
||||
retval = krb5_store_some_creds(context, *cc_other, cc_def_creds_arr,
|
||||
diff --git a/src/clients/ksu/ksu.h b/src/clients/ksu/ksu.h
|
||||
index e1e34f1..08bf01b 100644
|
||||
--- a/src/clients/ksu/ksu.h
|
||||
+++ b/src/clients/ksu/ksu.h
|
||||
@@ -106,8 +106,8 @@ extern krb5_error_code get_best_principal
|
||||
|
||||
/* ccache.c */
|
||||
extern krb5_error_code krb5_ccache_copy
|
||||
-(krb5_context, krb5_ccache, char *, krb5_principal,
|
||||
- krb5_boolean, krb5_ccache *, krb5_boolean *, uid_t);
|
||||
+(krb5_context, krb5_ccache, char *, krb5_principal, krb5_boolean,
|
||||
+ krb5_principal, krb5_ccache *, krb5_boolean *, uid_t);
|
||||
|
||||
extern krb5_error_code krb5_store_all_creds
|
||||
(krb5_context, krb5_ccache, krb5_creds **, krb5_creds **);
|
||||
diff --git a/src/clients/ksu/main.c b/src/clients/ksu/main.c
|
||||
index 8c49f94..d1bb8ca 100644
|
||||
--- a/src/clients/ksu/main.c
|
||||
+++ b/src/clients/ksu/main.c
|
||||
@@ -42,10 +42,13 @@ char * gb_err = NULL;
|
||||
int quiet = 0;
|
||||
/***********/
|
||||
|
||||
+#define KS_TEMPORARY_CACHE "MEMORY:_ksu"
|
||||
+#define KS_TEMPORARY_PRINC "_ksu/_ksu@_ksu"
|
||||
#define _DEF_CSH "/bin/csh"
|
||||
static int set_env_var (char *, char *);
|
||||
static void sweep_up (krb5_context, krb5_ccache);
|
||||
static char * ontty (void);
|
||||
+static krb5_error_code set_ccname_env(krb5_context, krb5_ccache);
|
||||
static void print_status( const char *fmt, ...)
|
||||
#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 7)
|
||||
__attribute__ ((__format__ (__printf__, 1, 2)))
|
||||
@@ -84,8 +87,8 @@ main (argc, argv)
|
||||
int option=0;
|
||||
int statusp=0;
|
||||
krb5_error_code retval = 0;
|
||||
- krb5_principal client = NULL;
|
||||
- krb5_ccache cc_target = NULL;
|
||||
+ krb5_principal client = NULL, tmp_princ = NULL;
|
||||
+ krb5_ccache cc_tmp = NULL, cc_target = NULL;
|
||||
krb5_context ksu_context;
|
||||
char * cc_target_tag = NULL;
|
||||
char * target_user = NULL;
|
||||
@@ -93,7 +96,6 @@ main (argc, argv)
|
||||
|
||||
krb5_ccache cc_source = NULL;
|
||||
const char * cc_source_tag = NULL;
|
||||
- uid_t source_gid;
|
||||
const char * cc_source_tag_tmp = NULL;
|
||||
char * cmd = NULL, * exec_cmd = NULL;
|
||||
int errflg = 0;
|
||||
@@ -342,8 +344,6 @@ main (argc, argv)
|
||||
/* allocate space and copy the usernamane there */
|
||||
source_user = xstrdup(pwd->pw_name);
|
||||
source_uid = pwd->pw_uid;
|
||||
- source_gid = pwd->pw_gid;
|
||||
-
|
||||
|
||||
if (!strcmp(SOURCE_USER_LOGIN, target_user)){
|
||||
target_user = xstrdup (source_user);
|
||||
@@ -435,25 +435,32 @@ main (argc, argv)
|
||||
}
|
||||
|
||||
/*
|
||||
- Only when proper authentication and authorization
|
||||
- takes place, the target user becomes the owner of the cache.
|
||||
- */
|
||||
-
|
||||
- /* we continue to run as source uid until
|
||||
- the middle of the copy, when becomewe become the target user
|
||||
- The cache is owned by the target user.*/
|
||||
+ * After proper authentication and authorization, populate a cache for the
|
||||
+ * target user.
|
||||
+ */
|
||||
|
||||
+ /*
|
||||
+ * We read the set of creds we want to copy from the source ccache as the
|
||||
+ * source uid, become root for authentication, and then become the target
|
||||
+ * user to handle authorization and creating the target user's cache.
|
||||
+ */
|
||||
|
||||
/* if root ksu's to a regular user, then
|
||||
then only the credentials for that particular user
|
||||
should be copied */
|
||||
|
||||
restrict_creds = (source_uid == 0) && (target_uid != 0);
|
||||
- retval = krb5_ccache_copy(ksu_context, cc_source, cc_target_tag, client,
|
||||
- restrict_creds, &cc_target, &stored, target_uid);
|
||||
+ retval = krb5_parse_name(ksu_context, KS_TEMPORARY_PRINC, &tmp_princ);
|
||||
+ if (retval) {
|
||||
+ com_err(prog_name, retval, _("while parsing temporary name"));
|
||||
+ exit(1);
|
||||
+ }
|
||||
+ retval = krb5_ccache_copy(ksu_context, cc_source, KS_TEMPORARY_CACHE,
|
||||
+ client, restrict_creds, tmp_princ, &cc_tmp,
|
||||
+ &stored, 0);
|
||||
if (retval) {
|
||||
com_err(prog_name, retval, _("while copying cache %s to %s"),
|
||||
- krb5_cc_get_name(ksu_context, cc_source), cc_target_tag);
|
||||
+ krb5_cc_get_name(ksu_context, cc_source), KS_TEMPORARY_CACHE);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
@@ -473,7 +480,6 @@ main (argc, argv)
|
||||
&kdc_server))){
|
||||
com_err(prog_name, retval,
|
||||
_("while creating tgt for local realm"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
@@ -481,13 +487,12 @@ main (argc, argv)
|
||||
"enter it here and are logged\n"));
|
||||
fprintf(stderr, _(" in remotely using an unsecure "
|
||||
"(non-encrypted) channel.\n"));
|
||||
- if (krb5_get_tkt_via_passwd (ksu_context, &cc_target, client,
|
||||
- kdc_server, &options,
|
||||
- &zero_password) == FALSE){
|
||||
+ if (krb5_get_tkt_via_passwd(ksu_context, &cc_tmp, client,
|
||||
+ kdc_server, &options,
|
||||
+ &zero_password) == FALSE){
|
||||
|
||||
if (zero_password == FALSE){
|
||||
fprintf(stderr, _("Goodbye\n"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
@@ -506,48 +511,20 @@ main (argc, argv)
|
||||
if (source_uid && (source_uid != target_uid)) {
|
||||
char * client_name;
|
||||
|
||||
- auth_val = krb5_auth_check(ksu_context, client, localhostname, &options,
|
||||
- target_user,cc_target, &path_passwd, target_uid);
|
||||
+ auth_val = krb5_auth_check(ksu_context, client, localhostname,
|
||||
+ &options, target_user, cc_tmp,
|
||||
+ &path_passwd, target_uid);
|
||||
|
||||
/* if Kerberos authentication failed then exit */
|
||||
if (auth_val ==FALSE){
|
||||
fprintf(stderr, _("Authentication failed.\n"));
|
||||
syslog(LOG_WARNING, "'%s %s' authentication failed for %s%s",
|
||||
prog_name,target_user,source_user,ontty());
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
-#if 0
|
||||
- /* At best, this avoids a single kdc request
|
||||
- It is hard to implement dealing with file permissions and
|
||||
- is unnecessary. It is important
|
||||
- to properly handle races in chown if this code is ever re-enabled.
|
||||
- */
|
||||
- /* cache the tickets if possible in the source cache */
|
||||
- if (!path_passwd){
|
||||
-
|
||||
- if ((retval = krb5_ccache_overwrite(ksu_context, cc_target, cc_source,
|
||||
- client))){
|
||||
- com_err (prog_name, retval,
|
||||
- "while copying cache %s to %s",
|
||||
- krb5_cc_get_name(ksu_context, cc_target),
|
||||
- krb5_cc_get_name(ksu_context, cc_source));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
- exit(1);
|
||||
- }
|
||||
- if (chown(cc_source_tag_tmp, source_uid, source_gid)){
|
||||
- com_err(prog_name, errno,
|
||||
- "while changing owner for %s",
|
||||
- cc_source_tag_tmp);
|
||||
- exit(1);
|
||||
- }
|
||||
- }
|
||||
-#endif /*0*/
|
||||
-
|
||||
if ((retval = krb5_unparse_name(ksu_context, client, &client_name))) {
|
||||
com_err(prog_name, retval, _("When unparsing name"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
@@ -560,7 +537,6 @@ main (argc, argv)
|
||||
if (krb5_seteuid(target_uid)) {
|
||||
com_err(prog_name, errno, _("while switching to target for "
|
||||
"authorization check"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
@@ -568,14 +544,12 @@ main (argc, argv)
|
||||
cmd, &authorization_val, &exec_cmd))){
|
||||
com_err(prog_name,retval, _("while checking authorization"));
|
||||
krb5_seteuid(0); /*So we have some chance of sweeping up*/
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
if (krb5_seteuid(0)) {
|
||||
com_err(prog_name, errno, _("while switching back from target "
|
||||
"after authorization check"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
if (authorization_val == TRUE){
|
||||
@@ -617,25 +591,25 @@ main (argc, argv)
|
||||
|
||||
}
|
||||
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
}
|
||||
|
||||
if( some_rest_copy){
|
||||
- if ((retval = krb5_ccache_filter(ksu_context, cc_target, client))){
|
||||
+ retval = krb5_ccache_filter(ksu_context, cc_tmp, client);
|
||||
+ if (retval) {
|
||||
com_err(prog_name,retval, _("while calling cc_filter"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
}
|
||||
|
||||
if (all_rest_copy){
|
||||
- if ((retval = krb5_cc_initialize(ksu_context, cc_target, client))){
|
||||
+ retval = krb5_cc_initialize(ksu_context, cc_tmp, tmp_princ);
|
||||
+ if (retval) {
|
||||
com_err(prog_name, retval, _("while erasing target cache"));
|
||||
exit(1);
|
||||
}
|
||||
-
|
||||
+ stored = FALSE;
|
||||
}
|
||||
|
||||
/* get the shell of the user, this will be the shell used by su */
|
||||
@@ -653,7 +627,6 @@ main (argc, argv)
|
||||
|
||||
if (!standard_shell(target_pwd->pw_shell) && source_uid) {
|
||||
fprintf(stderr, _("ksu: permission denied (shell).\n"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
#endif /* HAVE_GETUSERSHELL */
|
||||
@@ -663,43 +636,28 @@ main (argc, argv)
|
||||
if(set_env_var("USER", target_pwd->pw_name)){
|
||||
fprintf(stderr,
|
||||
_("ksu: couldn't set environment variable USER\n"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
}
|
||||
|
||||
if(set_env_var( "HOME", target_pwd->pw_dir)){
|
||||
fprintf(stderr, _("ksu: couldn't set environment variable HOME\n"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
if(set_env_var( "SHELL", shell)){
|
||||
fprintf(stderr, _("ksu: couldn't set environment variable SHELL\n"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
- exit(1);
|
||||
- }
|
||||
-
|
||||
- /* set the cc env name to target */
|
||||
-
|
||||
- if(set_env_var( KRB5_ENV_CCNAME, cc_target_tag)){
|
||||
- fprintf(stderr, _("ksu: couldn't set environment variable %s\n"),
|
||||
- KRB5_ENV_CCNAME);
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
/* set permissions */
|
||||
if (setgid(target_pwd->pw_gid) < 0) {
|
||||
perror("ksu: setgid");
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
-
|
||||
if (initgroups(target_user, target_pwd->pw_gid)) {
|
||||
fprintf(stderr, _("ksu: initgroups failed.\n"));
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
|
||||
@@ -719,13 +677,36 @@ main (argc, argv)
|
||||
*/
|
||||
if (setluid((uid_t) pwd->pw_uid) < 0) {
|
||||
perror("setluid");
|
||||
- sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
#endif /* HAVE_SETLUID */
|
||||
|
||||
if (setuid(target_pwd->pw_uid) < 0) {
|
||||
perror("ksu: setuid");
|
||||
+ exit(1);
|
||||
+ }
|
||||
+
|
||||
+ retval = krb5_ccache_copy(ksu_context, cc_tmp, cc_target_tag,
|
||||
+ client, FALSE, client, &cc_target, &stored,
|
||||
+ target_pwd->pw_uid);
|
||||
+ if (retval) {
|
||||
+ com_err(prog_name, retval, _("while copying cache %s to %s"),
|
||||
+ KS_TEMPORARY_CACHE, cc_target_tag);
|
||||
+ exit(1);
|
||||
+ }
|
||||
+
|
||||
+ if (stored && !ks_ccache_is_initialized(ksu_context, cc_target)) {
|
||||
+ com_err(prog_name, errno,
|
||||
+ _("%s does not have correct permissions for %s, %s aborted"),
|
||||
+ target_user, cc_target_tag, prog_name);
|
||||
+ exit(1);
|
||||
+ }
|
||||
+
|
||||
+ free(cc_target_tag);
|
||||
+
|
||||
+ /* Set the cc env name to target. */
|
||||
+ retval = set_ccname_env(ksu_context, cc_target);
|
||||
+ if (retval != 0) {
|
||||
sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
@@ -799,6 +780,29 @@ main (argc, argv)
|
||||
}
|
||||
}
|
||||
|
||||
+/* Set KRB5CCNAME in the environment to point to ccache. Print an error
|
||||
+ * message on failure. */
|
||||
+static krb5_error_code
|
||||
+set_ccname_env(krb5_context ksu_context, krb5_ccache ccache)
|
||||
+{
|
||||
+ krb5_error_code retval;
|
||||
+ char *ccname;
|
||||
+
|
||||
+ retval = krb5_cc_get_full_name(ksu_context, ccache, &ccname);
|
||||
+ if (retval) {
|
||||
+ com_err(prog_name, retval, _("while reading cache name from ccache"));
|
||||
+ return retval;
|
||||
+ }
|
||||
+ if (set_env_var(KRB5_ENV_CCNAME, ccname)) {
|
||||
+ retval = errno;
|
||||
+ fprintf(stderr,
|
||||
+ _("ksu: couldn't set environment variable %s\n"),
|
||||
+ KRB5_ENV_CCNAME);
|
||||
+ }
|
||||
+ krb5_free_string(ksu_context, ccname);
|
||||
+ return retval;
|
||||
+}
|
||||
+
|
||||
#ifdef HAVE_GETUSERSHELL
|
||||
|
||||
int standard_shell(sh)
|
||||
--
|
||||
2.0.4
|
||||
|
||||
@ -1,378 +0,0 @@
|
||||
From 3a456898af626dcab4e1ab0749ca2ccb9ad6162b Mon Sep 17 00:00:00 2001
|
||||
From: Nalin Dahyabhai <nalin@dahyabhai.net>
|
||||
Date: Wed, 30 Oct 2013 21:47:14 -0400
|
||||
Subject: [PATCH 4/7] Make ksu respect the default_ccache_name setting
|
||||
|
||||
Move the logic for resolving and initializing a cache that we're
|
||||
copying creds into out of krb5_ccache_copy(), and let the caller deal
|
||||
with it. Add a helper functions to select/resolve an output ccache in
|
||||
the default location for the target user after we've switched to the
|
||||
target user's privileges. If the destination is a collection, take
|
||||
care not to change which subsidiary is its primary, and reuse a
|
||||
subsidiary cache if we can. If the destination is not a collection,
|
||||
append a unique value to its name to make a new ccache.
|
||||
|
||||
[ghudson@mit.edu: some changes to variable names and comments; move
|
||||
responsibility for getting target ccache name from
|
||||
resolve_target_ccache to main]
|
||||
|
||||
ticket: 7984 (new)
|
||||
---
|
||||
src/clients/ksu/ccache.c | 35 +++------
|
||||
src/clients/ksu/ksu.h | 6 +-
|
||||
src/clients/ksu/main.c | 181 ++++++++++++++++++++++++++++++++++++++---------
|
||||
3 files changed, 157 insertions(+), 65 deletions(-)
|
||||
|
||||
diff --git a/src/clients/ksu/ccache.c b/src/clients/ksu/ccache.c
|
||||
index d0fc389..4693bd4 100644
|
||||
--- a/src/clients/ksu/ccache.c
|
||||
+++ b/src/clients/ksu/ccache.c
|
||||
@@ -46,59 +46,41 @@ void show_credential();
|
||||
with k5 beta 3 release.
|
||||
*/
|
||||
|
||||
-krb5_error_code krb5_ccache_copy (context, cc_def, cc_other_tag,
|
||||
- primary_principal, restrict_creds,
|
||||
- target_principal, cc_out, stored, target_uid)
|
||||
+krb5_error_code krb5_ccache_copy(context, cc_def, target_principal, cc_target,
|
||||
+ restrict_creds, primary_principal, stored)
|
||||
/* IN */
|
||||
krb5_context context;
|
||||
krb5_ccache cc_def;
|
||||
- char *cc_other_tag;
|
||||
- krb5_principal primary_principal;
|
||||
- krb5_boolean restrict_creds;
|
||||
krb5_principal target_principal;
|
||||
- uid_t target_uid;
|
||||
+ krb5_ccache cc_target;
|
||||
+ krb5_boolean restrict_creds;
|
||||
+ krb5_principal primary_principal;
|
||||
/* OUT */
|
||||
- krb5_ccache *cc_out;
|
||||
krb5_boolean *stored;
|
||||
{
|
||||
int i=0;
|
||||
- krb5_ccache * cc_other;
|
||||
krb5_error_code retval=0;
|
||||
krb5_creds ** cc_def_creds_arr = NULL;
|
||||
krb5_creds ** cc_other_creds_arr = NULL;
|
||||
|
||||
- cc_other = (krb5_ccache *) xcalloc(1, sizeof (krb5_ccache));
|
||||
-
|
||||
- if ((retval = krb5_cc_resolve(context, cc_other_tag, cc_other))){
|
||||
- com_err(prog_name, retval, _("resolving ccache %s"), cc_other_tag);
|
||||
- return retval;
|
||||
- }
|
||||
-
|
||||
if (ks_ccache_is_initialized(context, cc_def)) {
|
||||
if((retval = krb5_get_nonexp_tkts(context,cc_def,&cc_def_creds_arr))){
|
||||
return retval;
|
||||
}
|
||||
}
|
||||
|
||||
- if (ks_ccache_name_is_initialized(context, cc_other_tag))
|
||||
- return EINVAL;
|
||||
-
|
||||
- if (krb5_seteuid(0)||krb5_seteuid(target_uid)) {
|
||||
- return errno;
|
||||
- }
|
||||
-
|
||||
- retval = krb5_cc_initialize(context, *cc_other, target_principal);
|
||||
+ retval = krb5_cc_initialize(context, cc_target, target_principal);
|
||||
if (retval)
|
||||
return retval;
|
||||
|
||||
if (restrict_creds) {
|
||||
- retval = krb5_store_some_creds(context, *cc_other, cc_def_creds_arr,
|
||||
+ retval = krb5_store_some_creds(context, cc_target, cc_def_creds_arr,
|
||||
cc_other_creds_arr, primary_principal,
|
||||
stored);
|
||||
} else {
|
||||
*stored = krb5_find_princ_in_cred_list(context, cc_def_creds_arr,
|
||||
primary_principal);
|
||||
- retval = krb5_store_all_creds(context, *cc_other, cc_def_creds_arr,
|
||||
+ retval = krb5_store_all_creds(context, cc_target, cc_def_creds_arr,
|
||||
cc_other_creds_arr);
|
||||
}
|
||||
|
||||
@@ -118,7 +100,6 @@ krb5_error_code krb5_ccache_copy (context, cc_def, cc_other_tag,
|
||||
}
|
||||
}
|
||||
|
||||
- *cc_out = *cc_other;
|
||||
return retval;
|
||||
}
|
||||
|
||||
diff --git a/src/clients/ksu/ksu.h b/src/clients/ksu/ksu.h
|
||||
index 08bf01b..fbbf217 100644
|
||||
--- a/src/clients/ksu/ksu.h
|
||||
+++ b/src/clients/ksu/ksu.h
|
||||
@@ -44,8 +44,6 @@
|
||||
#define KRB5_DEFAULT_OPTIONS 0
|
||||
#define KRB5_DEFAULT_TKT_LIFE 60*60*12 /* 12 hours */
|
||||
|
||||
-#define KRB5_SECONDARY_CACHE "FILE:/tmp/krb5cc_"
|
||||
-
|
||||
#define KRB5_LOGIN_NAME ".k5login"
|
||||
#define KRB5_USERS_NAME ".k5users"
|
||||
#define USE_DEFAULT_REALM_NAME "."
|
||||
@@ -106,8 +104,8 @@ extern krb5_error_code get_best_principal
|
||||
|
||||
/* ccache.c */
|
||||
extern krb5_error_code krb5_ccache_copy
|
||||
-(krb5_context, krb5_ccache, char *, krb5_principal, krb5_boolean,
|
||||
- krb5_principal, krb5_ccache *, krb5_boolean *, uid_t);
|
||||
+(krb5_context, krb5_ccache, krb5_principal, krb5_ccache,
|
||||
+ krb5_boolean, krb5_principal, krb5_boolean *);
|
||||
|
||||
extern krb5_error_code krb5_store_all_creds
|
||||
(krb5_context, krb5_ccache, krb5_creds **, krb5_creds **);
|
||||
diff --git a/src/clients/ksu/main.c b/src/clients/ksu/main.c
|
||||
index d1bb8ca..41a3bf8 100644
|
||||
--- a/src/clients/ksu/main.c
|
||||
+++ b/src/clients/ksu/main.c
|
||||
@@ -54,6 +54,10 @@ static void print_status( const char *fmt, ...)
|
||||
__attribute__ ((__format__ (__printf__, 1, 2)))
|
||||
#endif
|
||||
;
|
||||
+static krb5_error_code resolve_target_cache(krb5_context ksu_context,
|
||||
+ krb5_principal princ,
|
||||
+ krb5_ccache *ccache_out,
|
||||
+ krb5_boolean *ccache_reused);
|
||||
|
||||
/* Note -e and -a options are mutually exclusive */
|
||||
/* insure the proper specification of target user as well as catching
|
||||
@@ -112,7 +116,7 @@ main (argc, argv)
|
||||
extern char * getpass(), *crypt();
|
||||
int pargc;
|
||||
char ** pargv;
|
||||
- krb5_boolean stored = FALSE;
|
||||
+ krb5_boolean stored = FALSE, cc_reused = FALSE;
|
||||
krb5_principal kdc_server;
|
||||
krb5_boolean zero_password;
|
||||
krb5_boolean restrict_creds;
|
||||
@@ -416,23 +420,8 @@ main (argc, argv)
|
||||
exit(1);
|
||||
}
|
||||
|
||||
- /*
|
||||
- * Make sure that the new ticket file does not already exist.
|
||||
- * This is run as source_uid because it is reasonable to
|
||||
- * require the source user to have write to where the target
|
||||
- * cache will be created.
|
||||
- */
|
||||
- cc_target_tag = (char *)xcalloc(KRB5_SEC_BUFFSIZE, sizeof(char));
|
||||
- do {
|
||||
- snprintf(cc_target_tag, KRB5_SEC_BUFFSIZE, "%s%ld.%d",
|
||||
- KRB5_SECONDARY_CACHE,
|
||||
- (long)target_uid, gen_sym());
|
||||
- } while (ks_ccache_name_is_initialized(ksu_context, cc_target_tag));
|
||||
-
|
||||
- if (auth_debug){
|
||||
+ if (auth_debug)
|
||||
fprintf(stderr, " source cache = %s\n", cc_source_tag);
|
||||
- fprintf(stderr, " target cache = %s\n", cc_target_tag);
|
||||
- }
|
||||
|
||||
/*
|
||||
* After proper authentication and authorization, populate a cache for the
|
||||
@@ -455,14 +444,19 @@ main (argc, argv)
|
||||
com_err(prog_name, retval, _("while parsing temporary name"));
|
||||
exit(1);
|
||||
}
|
||||
- retval = krb5_ccache_copy(ksu_context, cc_source, KS_TEMPORARY_CACHE,
|
||||
- client, restrict_creds, tmp_princ, &cc_tmp,
|
||||
- &stored, 0);
|
||||
+ retval = krb5_cc_resolve(ksu_context, KS_TEMPORARY_CACHE, &cc_tmp);
|
||||
+ if (retval) {
|
||||
+ com_err(prog_name, retval, _("while creating temporary cache"));
|
||||
+ exit(1);
|
||||
+ }
|
||||
+ retval = krb5_ccache_copy(ksu_context, cc_source, tmp_princ, cc_tmp,
|
||||
+ restrict_creds, client, &stored);
|
||||
if (retval) {
|
||||
com_err(prog_name, retval, _("while copying cache %s to %s"),
|
||||
krb5_cc_get_name(ksu_context, cc_source), KS_TEMPORARY_CACHE);
|
||||
exit(1);
|
||||
}
|
||||
+ krb5_cc_close(ksu_context, cc_source);
|
||||
|
||||
/* Become root for authentication*/
|
||||
|
||||
@@ -686,23 +680,38 @@ main (argc, argv)
|
||||
exit(1);
|
||||
}
|
||||
|
||||
- retval = krb5_ccache_copy(ksu_context, cc_tmp, cc_target_tag,
|
||||
- client, FALSE, client, &cc_target, &stored,
|
||||
- target_pwd->pw_uid);
|
||||
+ retval = resolve_target_cache(ksu_context, client, &cc_target, &cc_reused);
|
||||
+ if (retval)
|
||||
+ exit(1);
|
||||
+ retval = krb5_cc_get_full_name(ksu_context, cc_target, &cc_target_tag);
|
||||
if (retval) {
|
||||
- com_err(prog_name, retval, _("while copying cache %s to %s"),
|
||||
- KS_TEMPORARY_CACHE, cc_target_tag);
|
||||
+ com_err(prog_name, retval, _("while getting name of target ccache"));
|
||||
+ sweep_up(ksu_context, cc_target);
|
||||
exit(1);
|
||||
}
|
||||
+ if (auth_debug)
|
||||
+ fprintf(stderr, " target cache = %s\n", cc_target_tag);
|
||||
+ if (cc_reused)
|
||||
+ keep_target_cache = TRUE;
|
||||
|
||||
- if (stored && !ks_ccache_is_initialized(ksu_context, cc_target)) {
|
||||
- com_err(prog_name, errno,
|
||||
- _("%s does not have correct permissions for %s, %s aborted"),
|
||||
- target_user, cc_target_tag, prog_name);
|
||||
- exit(1);
|
||||
+ if (stored) {
|
||||
+ retval = krb5_ccache_copy(ksu_context, cc_tmp, client, cc_target,
|
||||
+ FALSE, client, &stored);
|
||||
+ if (retval) {
|
||||
+ com_err(prog_name, retval, _("while copying cache %s to %s"),
|
||||
+ KS_TEMPORARY_CACHE, cc_target_tag);
|
||||
+ exit(1);
|
||||
+ }
|
||||
+
|
||||
+ if (!ks_ccache_is_initialized(ksu_context, cc_target)) {
|
||||
+ com_err(prog_name, errno,
|
||||
+ _("%s does not have correct permissions for %s, "
|
||||
+ "%s aborted"), target_user, cc_target_tag, prog_name);
|
||||
+ exit(1);
|
||||
+ }
|
||||
}
|
||||
|
||||
- free(cc_target_tag);
|
||||
+ krb5_free_string(ksu_context, cc_target_tag);
|
||||
|
||||
/* Set the cc env name to target. */
|
||||
retval = set_ccname_env(ksu_context, cc_target);
|
||||
@@ -711,9 +720,6 @@ main (argc, argv)
|
||||
exit(1);
|
||||
}
|
||||
|
||||
- if ( cc_source)
|
||||
- krb5_cc_close(ksu_context, cc_source);
|
||||
-
|
||||
if (cmd){
|
||||
if ((source_uid == 0) || (source_uid == target_uid )){
|
||||
exec_cmd = cmd;
|
||||
@@ -803,6 +809,113 @@ set_ccname_env(krb5_context ksu_context, krb5_ccache ccache)
|
||||
return retval;
|
||||
}
|
||||
|
||||
+/*
|
||||
+ * Get the configured default ccache name. Unset KRB5CCNAME and force a
|
||||
+ * recomputation so we don't use values for the source user. Print an error
|
||||
+ * message on failure.
|
||||
+ */
|
||||
+static krb5_error_code
|
||||
+get_configured_defccname(krb5_context context, char **target_out)
|
||||
+{
|
||||
+ krb5_error_code retval;
|
||||
+ const char *defname;
|
||||
+ char *target;
|
||||
+
|
||||
+ *target_out = NULL;
|
||||
+
|
||||
+ if (unsetenv(KRB5_ENV_CCNAME) != 0) {
|
||||
+ retval = errno;
|
||||
+ com_err(prog_name, retval, _("while clearing the value of %s"),
|
||||
+ KRB5_ENV_CCNAME);
|
||||
+ return retval;
|
||||
+ }
|
||||
+
|
||||
+ /* Make sure we don't have a cached value for a different uid. */
|
||||
+ retval = krb5_cc_set_default_name(context, NULL);
|
||||
+ if (retval != 0) {
|
||||
+ com_err(prog_name, retval, _("while resetting target ccache name"));
|
||||
+ return retval;
|
||||
+ }
|
||||
+
|
||||
+ defname = krb5_cc_default_name(context);
|
||||
+ target = (defname == NULL) ? NULL : strdup(defname);
|
||||
+ if (target == NULL) {
|
||||
+ com_err(prog_name, ENOMEM, _("while determining target ccache name"));
|
||||
+ return ENOMEM;
|
||||
+ }
|
||||
+ *target_out = target;
|
||||
+ return 0;
|
||||
+}
|
||||
+
|
||||
+/* Determine where the target user's creds should be stored. Print an error
|
||||
+ * message on failure. */
|
||||
+static krb5_error_code
|
||||
+resolve_target_cache(krb5_context context, krb5_principal princ,
|
||||
+ krb5_ccache *ccache_out, krb5_boolean *ccache_reused)
|
||||
+{
|
||||
+ krb5_error_code retval;
|
||||
+ krb5_boolean switchable, reused = FALSE;
|
||||
+ krb5_ccache ccache = NULL;
|
||||
+ char *sep, *ccname = NULL, *target;
|
||||
+
|
||||
+ *ccache_out = NULL;
|
||||
+ *ccache_reused = FALSE;
|
||||
+
|
||||
+ retval = get_configured_defccname(context, &target);
|
||||
+ if (retval != 0)
|
||||
+ return retval;
|
||||
+
|
||||
+ /* Check if the configured default name uses a switchable type. */
|
||||
+ sep = strchr(target, ':');
|
||||
+ *sep = '\0';
|
||||
+ switchable = krb5_cc_support_switch(context, target);
|
||||
+ *sep = ':';
|
||||
+
|
||||
+ if (!switchable) {
|
||||
+ /* Try to avoid destroying an in-use target ccache by coming up with
|
||||
+ * the name of a cache that doesn't exist yet. */
|
||||
+ do {
|
||||
+ free(ccname);
|
||||
+ if (asprintf(&ccname, "%s.%d", target, gen_sym()) < 0) {
|
||||
+ retval = ENOMEM;
|
||||
+ com_err(prog_name, ENOMEM,
|
||||
+ _("while allocating memory for target ccache name"));
|
||||
+ goto cleanup;
|
||||
+ }
|
||||
+ } while (ks_ccache_name_is_initialized(context, ccname));
|
||||
+ retval = krb5_cc_resolve(context, ccname, &ccache);
|
||||
+ } else {
|
||||
+ /* Look for a cache in the collection that we can reuse. */
|
||||
+ retval = krb5_cc_cache_match(context, princ, &ccache);
|
||||
+ if (retval == 0) {
|
||||
+ reused = TRUE;
|
||||
+ } else {
|
||||
+ /* There isn't one, so create a new one. */
|
||||
+ *sep = '\0';
|
||||
+ retval = krb5_cc_new_unique(context, target, NULL, &ccache);
|
||||
+ *sep = ':';
|
||||
+ if (retval) {
|
||||
+ com_err(prog_name, retval,
|
||||
+ _("while creating new target ccache"));
|
||||
+ goto cleanup;
|
||||
+ }
|
||||
+ retval = krb5_cc_initialize(context, ccache, princ);
|
||||
+ if (retval) {
|
||||
+ com_err(prog_name, retval,
|
||||
+ _("while initializing target cache"));
|
||||
+ goto cleanup;
|
||||
+ }
|
||||
+ }
|
||||
+ }
|
||||
+
|
||||
+ *ccache_out = ccache;
|
||||
+ *ccache_reused = reused;
|
||||
+
|
||||
+cleanup:
|
||||
+ free(target);
|
||||
+ return retval;
|
||||
+}
|
||||
+
|
||||
#ifdef HAVE_GETUSERSHELL
|
||||
|
||||
int standard_shell(sh)
|
||||
--
|
||||
2.0.4
|
||||
|
||||
@ -1,30 +0,0 @@
|
||||
From 297496f0938955ba4aaf0ebecf4e393e527b8cbf Mon Sep 17 00:00:00 2001
|
||||
From: Nalin Dahyabhai <nalin@dahyabhai.net>
|
||||
Date: Tue, 29 Oct 2013 16:27:20 -0400
|
||||
Subject: [PATCH 5/7] Copy config entries to the ksu target ccache
|
||||
|
||||
When we try to screen out expired creds while reading them from one
|
||||
ccache to eventually store in another, also keep configuration entries.
|
||||
|
||||
ticket: 7986 (new)
|
||||
---
|
||||
src/clients/ksu/ccache.c | 3 ++-
|
||||
1 file changed, 2 insertions(+), 1 deletion(-)
|
||||
|
||||
diff --git a/src/clients/ksu/ccache.c b/src/clients/ksu/ccache.c
|
||||
index 4693bd4..0f9e042 100644
|
||||
--- a/src/clients/ksu/ccache.c
|
||||
+++ b/src/clients/ksu/ccache.c
|
||||
@@ -219,7 +219,8 @@ krb5_error_code krb5_get_nonexp_tkts(context, cc, creds_array)
|
||||
|
||||
while (!(retval = krb5_cc_next_cred(context, cc, &cur, &creds))){
|
||||
|
||||
- if ((retval = krb5_check_exp(context, creds.times))){
|
||||
+ if (!krb5_is_config_principal(context, creds.server) &&
|
||||
+ (retval = krb5_check_exp(context, creds.times))){
|
||||
if (retval != KRB5KRB_AP_ERR_TKT_EXPIRED){
|
||||
return retval;
|
||||
}
|
||||
--
|
||||
2.0.4
|
||||
|
||||
@ -1,115 +0,0 @@
|
||||
From 69c8e20b18577781e17c5959e23514134dfb5755 Mon Sep 17 00:00:00 2001
|
||||
From: Nalin Dahyabhai <nalin@redhat.com>
|
||||
Date: Thu, 24 Jul 2014 16:43:21 -0400
|
||||
Subject: [PATCH 6/7] Use more randomness for ksu secondary cache names
|
||||
|
||||
When generating a suffix to append to a ccache name that will hold the
|
||||
credentials for a ksu-invoked process, instead of using integers
|
||||
counting up from 1, use the result of base64-encoding six randomly-
|
||||
generated octets. Tweak the output alphabet just a bit to avoid using
|
||||
'+' or '/' in the generated names, the latter of which could really
|
||||
confuse things.
|
||||
---
|
||||
src/clients/ksu/ccache.c | 27 +++++++++++++++++++++++----
|
||||
src/clients/ksu/ksu.h | 2 +-
|
||||
src/clients/ksu/main.c | 16 ++++++++++++----
|
||||
3 files changed, 36 insertions(+), 9 deletions(-)
|
||||
|
||||
diff --git a/src/clients/ksu/ccache.c b/src/clients/ksu/ccache.c
|
||||
index 0f9e042..a0736f2 100644
|
||||
--- a/src/clients/ksu/ccache.c
|
||||
+++ b/src/clients/ksu/ccache.c
|
||||
@@ -27,6 +27,7 @@
|
||||
*/
|
||||
|
||||
#include "ksu.h"
|
||||
+#include "k5-base64.h"
|
||||
#include "adm_proto.h"
|
||||
#include <sys/types.h>
|
||||
#include <sys/stat.h>
|
||||
@@ -504,10 +505,28 @@ show_credential(context, cred, cc)
|
||||
free(sname);
|
||||
}
|
||||
|
||||
-int gen_sym(){
|
||||
- static int i = 0;
|
||||
- i ++;
|
||||
- return i;
|
||||
+/* Create a random string suitable for a filename extension. */
|
||||
+krb5_error_code
|
||||
+gen_sym(krb5_context context, char **sym_out)
|
||||
+{
|
||||
+ krb5_error_code retval;
|
||||
+ char bytes[6], *p, *sym;
|
||||
+ krb5_data data = make_data(bytes, sizeof(bytes));
|
||||
+
|
||||
+ *sym_out = NULL;
|
||||
+ retval = krb5_c_random_make_octets(context, &data);
|
||||
+ if (retval)
|
||||
+ return retval;
|
||||
+ sym = k5_base64_encode(data.data, data.length);
|
||||
+ if (sym == NULL)
|
||||
+ return ENOMEM;
|
||||
+ /* Tweak the output alphabet just a bit. */
|
||||
+ while ((p = strchr(sym, '/')) != NULL)
|
||||
+ *p = '_';
|
||||
+ while ((p = strchr(sym, '+')) != NULL)
|
||||
+ *p = '-';
|
||||
+ *sym_out = sym;
|
||||
+ return 0;
|
||||
}
|
||||
|
||||
krb5_error_code krb5_ccache_overwrite(context, ccs, cct, primary_principal)
|
||||
diff --git a/src/clients/ksu/ksu.h b/src/clients/ksu/ksu.h
|
||||
index fbbf217..5ba5ceb 100644
|
||||
--- a/src/clients/ksu/ksu.h
|
||||
+++ b/src/clients/ksu/ksu.h
|
||||
@@ -130,7 +130,7 @@ extern krb5_error_code krb5_get_login_princ
|
||||
extern void show_credential
|
||||
(krb5_context, krb5_creds *, krb5_ccache);
|
||||
|
||||
-extern int gen_sym (void);
|
||||
+krb5_error_code gen_sym(krb5_context context, char **sym);
|
||||
|
||||
extern krb5_error_code krb5_ccache_overwrite
|
||||
(krb5_context, krb5_ccache, krb5_ccache, krb5_principal);
|
||||
diff --git a/src/clients/ksu/main.c b/src/clients/ksu/main.c
|
||||
index 41a3bf8..47fa820 100644
|
||||
--- a/src/clients/ksu/main.c
|
||||
+++ b/src/clients/ksu/main.c
|
||||
@@ -856,7 +856,7 @@ resolve_target_cache(krb5_context context, krb5_principal princ,
|
||||
krb5_error_code retval;
|
||||
krb5_boolean switchable, reused = FALSE;
|
||||
krb5_ccache ccache = NULL;
|
||||
- char *sep, *ccname = NULL, *target;
|
||||
+ char *sep, *ccname = NULL, *sym = NULL, *target;
|
||||
|
||||
*ccache_out = NULL;
|
||||
*ccache_reused = FALSE;
|
||||
@@ -876,12 +876,20 @@ resolve_target_cache(krb5_context context, krb5_principal princ,
|
||||
* the name of a cache that doesn't exist yet. */
|
||||
do {
|
||||
free(ccname);
|
||||
- if (asprintf(&ccname, "%s.%d", target, gen_sym()) < 0) {
|
||||
+ retval = gen_sym(context, &sym);
|
||||
+ if (retval) {
|
||||
+ com_err(prog_name, retval,
|
||||
+ _("while generating part of the target ccache name"));
|
||||
+ return retval;
|
||||
+ }
|
||||
+ if (asprintf(&ccname, "%s.%s", target, sym) < 0) {
|
||||
retval = ENOMEM;
|
||||
- com_err(prog_name, ENOMEM,
|
||||
- _("while allocating memory for target ccache name"));
|
||||
+ free(sym);
|
||||
+ com_err(prog_name, retval, _("while allocating memory for the "
|
||||
+ "target ccache name"));
|
||||
goto cleanup;
|
||||
}
|
||||
+ free(sym);
|
||||
} while (ks_ccache_name_is_initialized(context, ccname));
|
||||
retval = krb5_cc_resolve(context, ccname, &ccache);
|
||||
} else {
|
||||
--
|
||||
2.0.4
|
||||
|
||||
@ -1,37 +0,0 @@
|
||||
Context tweaked to apply to 1.12.1.
|
||||
|
||||
From bca1191210eb582fe09e94486e2631d72b8a5ca5 Mon Sep 17 00:00:00 2001
|
||||
From: Nalin Dahyabhai <nalin@redhat.com>
|
||||
Date: Fri, 8 Aug 2014 16:58:03 -0400
|
||||
Subject: [PATCH 7/7] Make krb5_cc_new_unique create DIR: directories
|
||||
|
||||
When we use krb5_cc_new_unique to create a new cache in a directory
|
||||
cache collection, we will fail if the directory doesn't exist yet.
|
||||
|
||||
Go ahead and preemptively create it, as we do during krb5_cc_resolve,
|
||||
before attempting to create a new file under it.
|
||||
|
||||
ticket: 7988 (new)
|
||||
target_version: 1.13
|
||||
tags: pullup
|
||||
---
|
||||
src/lib/krb5/ccache/cc_dir.c | 3 +++
|
||||
1 file changed, 3 insertions(+)
|
||||
|
||||
diff --git a/src/lib/krb5/ccache/cc_dir.c b/src/lib/krb5/ccache/cc_dir.c
|
||||
index d82f335..b00a6bb 100644
|
||||
--- a/src/lib/krb5/ccache/cc_dir.c
|
||||
+++ b/src/lib/krb5/ccache/cc_dir.c
|
||||
@@ -401,6 +401,9 @@ dcc_gen_new(krb5_context context, krb5_ccache *cache_out)
|
||||
"collection"));
|
||||
return KRB5_DCC_CANNOT_CREATE;
|
||||
}
|
||||
+ ret = verify_dir(context, dirname);
|
||||
+ if (ret)
|
||||
+ goto cleanup;
|
||||
ret = k5_path_join(dirname, "tktXXXXXX", &template);
|
||||
if (ret)
|
||||
goto cleanup;
|
||||
--
|
||||
2.0.4
|
||||
|
||||
@ -1,32 +0,0 @@
|
||||
Fall back to TCP on kdc-unresolvable/unreachable errors. We still have
|
||||
to wait for UDP to fail, so this might not be ideal. RT #5868.
|
||||
|
||||
--- krb5/src/lib/krb5/os/changepw.c
|
||||
+++ krb5/src/lib/krb5/os/changepw.c
|
||||
@@ -270,10 +270,22 @@ change_set_password(krb5_context context
|
||||
&callback_info, &chpw_rep, ss2sa(&remote_addr),
|
||||
&addrlen, NULL, NULL, NULL);
|
||||
if (code) {
|
||||
- /*
|
||||
- * Here we may want to switch to TCP on some errors.
|
||||
- * right?
|
||||
- */
|
||||
+ /* if we're not using a stream socket, and it's an error which
|
||||
+ * might reasonably be specific to a datagram "connection", try
|
||||
+ * again with a stream socket */
|
||||
+ if (!use_tcp) {
|
||||
+ switch (code) {
|
||||
+ case KRB5_KDC_UNREACH:
|
||||
+ case KRB5_REALM_CANT_RESOLVE:
|
||||
+ case KRB5KRB_ERR_RESPONSE_TOO_BIG:
|
||||
+ /* should we do this for more result codes than these? */
|
||||
+ k5_free_serverlist (&sl);
|
||||
+ use_tcp = 1;
|
||||
+ continue;
|
||||
+ default:
|
||||
+ break;
|
||||
+ }
|
||||
+ }
|
||||
break;
|
||||
}
|
||||
|
||||
@ -1,28 +0,0 @@
|
||||
Use an in-memory ccache to silence a compiler warning, for RT#6414.
|
||||
|
||||
--- krb5/src/slave/kprop.c
|
||||
+++ krb5/src/slave/kprop.c
|
||||
@@ -202,9 +202,8 @@ void PRS(argc, argv)
|
||||
void get_tickets(context)
|
||||
krb5_context context;
|
||||
{
|
||||
- char buf[BUFSIZ], *def_realm;
|
||||
+ char buf[] = "MEMORY:_kproptkt", *def_realm;
|
||||
krb5_error_code retval;
|
||||
- static char tkstring[] = "/tmp/kproptktXXXXXX";
|
||||
krb5_keytab keytab = NULL;
|
||||
|
||||
/*
|
||||
@@ -229,11 +228,8 @@ void get_tickets(context)
|
||||
#endif
|
||||
|
||||
/*
|
||||
- * Initialize cache file which we're going to be using
|
||||
+ * Initialize an in-memory cache for temporary use
|
||||
*/
|
||||
- (void) mktemp(tkstring);
|
||||
- snprintf(buf, sizeof(buf), "FILE:%s", tkstring);
|
||||
-
|
||||
retval = krb5_cc_resolve(context, buf, &ccache);
|
||||
if (retval) {
|
||||
com_err(progname, retval, _("while opening credential cache %s"), buf);
|
||||
@ -1,176 +0,0 @@
|
||||
From 230858394d2dded001ef3d2029daa6c468aca097 Mon Sep 17 00:00:00 2001
|
||||
From: Greg Hudson <ghudson@mit.edu>
|
||||
Date: Fri, 28 Feb 2014 14:49:35 -0500
|
||||
Subject: [PATCH] Use preauth options when changing password
|
||||
|
||||
If we try to change the password in rb5_get_init_creds_password, we
|
||||
must use all application-specified gic options which affect
|
||||
preauthentication when getting the kadmin/changepw ticket. Create a
|
||||
helper function make_chpw_options which copies the application's
|
||||
options, unsets the options we don't want, and sets options
|
||||
appropriate for a temporary ticket.
|
||||
|
||||
ticket: 7868
|
||||
|
||||
npmccallum:
|
||||
* include tests from 06817686bfdef99523f300464bcbb0c8b037a27d
|
||||
---
|
||||
src/lib/krb5/krb/gic_pwd.c | 63 +++++++++++++++++++++++++++++++++++++---------
|
||||
src/tests/Makefile.in | 1 +
|
||||
src/tests/t_changepw.py | 37 +++++++++++++++++++++++++++
|
||||
3 files changed, 89 insertions(+), 12 deletions(-)
|
||||
create mode 100644 src/tests/t_changepw.py
|
||||
|
||||
diff --git a/src/lib/krb5/krb/gic_pwd.c b/src/lib/krb5/krb/gic_pwd.c
|
||||
index a97823f6b51b7393755e82f36612c30b64096754..6aec7c3a71f99d2194b09374b296327174e6d4b8 100644
|
||||
--- a/src/lib/krb5/krb/gic_pwd.c
|
||||
+++ b/src/lib/krb5/krb/gic_pwd.c
|
||||
@@ -242,6 +242,54 @@ warn_pw_expiry(krb5_context context, krb5_get_init_creds_opt *options,
|
||||
(*prompter)(context, data, 0, banner, 0, 0);
|
||||
}
|
||||
|
||||
+/*
|
||||
+ * Create a temporary options structure for getting a kadmin/changepw ticket,
|
||||
+ * based on the appplication-specified options. Propagate all application
|
||||
+ * options which affect preauthentication, but not options which affect the
|
||||
+ * resulting ticket or how it is stored. Set lifetime and flags appropriate
|
||||
+ * for a ticket which we will use immediately and then discard.
|
||||
+ *
|
||||
+ * storage1 and storage2 will be used to hold the temporary options. The
|
||||
+ * caller must not free the result, as it will contain aliases into the
|
||||
+ * application options.
|
||||
+ */
|
||||
+static krb5_get_init_creds_opt *
|
||||
+make_chpw_options(krb5_get_init_creds_opt *in, krb5_gic_opt_ext *storage1,
|
||||
+ gic_opt_private *storage2)
|
||||
+{
|
||||
+ krb5_gic_opt_ext *in_ext;
|
||||
+ krb5_get_init_creds_opt *opt;
|
||||
+
|
||||
+ /* Copy the application's options to storage. */
|
||||
+ if (in == NULL) {
|
||||
+ storage1->flags = 0;
|
||||
+ } else if (gic_opt_is_extended(in)) {
|
||||
+ in_ext = (krb5_gic_opt_ext *)in;
|
||||
+ *storage1 = *in_ext;
|
||||
+ *storage2 = *in_ext->opt_private;
|
||||
+ storage1->opt_private = storage2;
|
||||
+ } else {
|
||||
+ *(krb5_get_init_creds_opt *)storage1 = *in;
|
||||
+ }
|
||||
+
|
||||
+ /* Get a non-forwardable, non-proxiable, short-lifetime ticket. */
|
||||
+ opt = (krb5_get_init_creds_opt *)storage1;
|
||||
+ krb5_get_init_creds_opt_set_tkt_life(opt, 5 * 60);
|
||||
+ krb5_get_init_creds_opt_set_renew_life(opt, 0);
|
||||
+ krb5_get_init_creds_opt_set_forwardable(opt, 0);
|
||||
+ krb5_get_init_creds_opt_set_proxiable(opt, 0);
|
||||
+
|
||||
+ /* Unset options which should only apply to the actual ticket. */
|
||||
+ opt->flags &= ~KRB5_GET_INIT_CREDS_OPT_ADDRESS_LIST;
|
||||
+ opt->flags &= ~KRB5_GET_INIT_CREDS_OPT_ANONYMOUS;
|
||||
+
|
||||
+ /* The output ccache should only be used for the actual ticket. */
|
||||
+ if (gic_opt_is_extended(opt))
|
||||
+ storage2->out_ccache = NULL;
|
||||
+
|
||||
+ return opt;
|
||||
+}
|
||||
+
|
||||
krb5_error_code KRB5_CALLCONV
|
||||
krb5_get_init_creds_password(krb5_context context,
|
||||
krb5_creds *creds,
|
||||
@@ -259,6 +307,8 @@ krb5_get_init_creds_password(krb5_context context,
|
||||
int tries;
|
||||
krb5_creds chpw_creds;
|
||||
krb5_get_init_creds_opt *chpw_opts = NULL;
|
||||
+ krb5_gic_opt_ext storage1;
|
||||
+ gic_opt_private storage2;
|
||||
struct gak_password gakpw;
|
||||
krb5_data pw0, pw1;
|
||||
char banner[1024], pw0array[1024], pw1array[1024];
|
||||
@@ -345,16 +395,7 @@ krb5_get_init_creds_password(krb5_context context,
|
||||
/* ok, we have an expired password. Give the user a few chances
|
||||
to change it */
|
||||
|
||||
- /* use a minimal set of options */
|
||||
-
|
||||
- ret = krb5_get_init_creds_opt_alloc(context, &chpw_opts);
|
||||
- if (ret)
|
||||
- goto cleanup;
|
||||
- krb5_get_init_creds_opt_set_tkt_life(chpw_opts, 5*60);
|
||||
- krb5_get_init_creds_opt_set_renew_life(chpw_opts, 0);
|
||||
- krb5_get_init_creds_opt_set_forwardable(chpw_opts, 0);
|
||||
- krb5_get_init_creds_opt_set_proxiable(chpw_opts, 0);
|
||||
-
|
||||
+ chpw_opts = make_chpw_options(options, &storage1, &storage2);
|
||||
ret = k5_get_init_creds(context, &chpw_creds, client, prompter, data,
|
||||
start_time, "kadmin/changepw", chpw_opts,
|
||||
krb5_get_as_key_password, &gakpw, &use_master,
|
||||
@@ -471,8 +512,6 @@ cleanup:
|
||||
warn_pw_expiry(context, options, prompter, data, in_tkt_service,
|
||||
as_reply);
|
||||
|
||||
- if (chpw_opts)
|
||||
- krb5_get_init_creds_opt_free(context, chpw_opts);
|
||||
zapfree(gakpw.storage.data, gakpw.storage.length);
|
||||
memset(pw0array, 0, sizeof(pw0array));
|
||||
memset(pw1array, 0, sizeof(pw1array));
|
||||
diff --git a/src/tests/Makefile.in b/src/tests/Makefile.in
|
||||
index 62523895d53da24844141a6ada6cab23e77dd9e6..55f1d6419f8d924a6f9a2971d36f1eac6d293d32 100644
|
||||
--- a/src/tests/Makefile.in
|
||||
+++ b/src/tests/Makefile.in
|
||||
@@ -94,6 +94,7 @@ check-pytests:: t_init_creds t_localauth
|
||||
$(RUNPYTEST) $(srcdir)/t_iprop.py $(PYTESTFLAGS)
|
||||
$(RUNPYTEST) $(srcdir)/t_kprop.py $(PYTESTFLAGS)
|
||||
$(RUNPYTEST) $(srcdir)/t_policy.py $(PYTESTFLAGS)
|
||||
+ $(RUNPYTEST) $(srcdir)/t_changepw.py $(PYTESTFLAGS)
|
||||
$(RUNPYTEST) $(srcdir)/t_pkinit.py $(PYTESTFLAGS)
|
||||
$(RUNPYTEST) $(srcdir)/t_otp.py $(PYTESTFLAGS)
|
||||
$(RUNPYTEST) $(srcdir)/t_localauth.py $(PYTESTFLAGS)
|
||||
diff --git a/src/tests/t_changepw.py b/src/tests/t_changepw.py
|
||||
new file mode 100644
|
||||
index 0000000000000000000000000000000000000000..0b9832668e618b3db8d88cf388ec918898bb4df3
|
||||
--- /dev/null
|
||||
+++ b/src/tests/t_changepw.py
|
||||
@@ -0,0 +1,37 @@
|
||||
+#!/usr/bin/python
|
||||
+from k5test import *
|
||||
+
|
||||
+# This file is intended to cover any password-changing mechanism. For
|
||||
+# now it only contains a regression test for #7868.
|
||||
+
|
||||
+realm = K5Realm(create_host=False, get_creds=False, start_kadmind=True)
|
||||
+
|
||||
+# Mark a principal as expired and change its password through kinit.
|
||||
+realm.run_kadminl('modprinc -pwexpire "1 day ago" user')
|
||||
+pwinput = password('user') + '\nabcd\nabcd\n'
|
||||
+realm.run([kinit, realm.user_princ], input=pwinput)
|
||||
+
|
||||
+# Do the same thing with FAST, with tracing turned on.
|
||||
+realm.run_kadminl('modprinc -pwexpire "1 day ago" user')
|
||||
+pwinput = 'abcd\nefgh\nefgh\n'
|
||||
+tracefile = os.path.join(realm.testdir, 'trace')
|
||||
+realm.run(['env', 'KRB5_TRACE=' + tracefile, kinit, '-T', realm.ccache,
|
||||
+ realm.user_princ], input=pwinput)
|
||||
+
|
||||
+# Read the trace and check that FAST was used when getting the
|
||||
+# kadmin/changepw ticket.
|
||||
+f = open(tracefile, 'r')
|
||||
+trace = f.read()
|
||||
+f.close()
|
||||
+getting_changepw = fast_used_for_changepw = False
|
||||
+for line in trace.splitlines():
|
||||
+ if 'Getting initial credentials for user@' in line:
|
||||
+ getting_changepw_ticket = False
|
||||
+ if 'Setting initial creds service to kadmin/changepw' in line:
|
||||
+ getting_changepw_ticket = True
|
||||
+ if getting_changepw_ticket and 'Using FAST' in line:
|
||||
+ fast_used_for_changepw = True
|
||||
+if not fast_used_for_changepw:
|
||||
+ fail('FAST was not used to get kadmin/changepw ticket')
|
||||
+
|
||||
+success('Password change tests')
|
||||
--
|
||||
1.8.5.3
|
||||
|
||||
@ -23,9 +23,9 @@ diff -up krb5-1.8/src/aclocal.m4.dirsrv-accountlock krb5-1.8/src/aclocal.m4
|
||||
diff -up krb5-1.8/src/plugins/kdb/ldap/libkdb_ldap/ldap_misc.c.dirsrv-accountlock krb5-1.8/src/plugins/kdb/ldap/libkdb_ldap/ldap_misc.c
|
||||
--- krb5-1.8/src/plugins/kdb/ldap/libkdb_ldap/ldap_misc.c.dirsrv-accountlock 2009-11-24 18:52:25.000000000 -0500
|
||||
+++ krb5-1.8/src/plugins/kdb/ldap/libkdb_ldap/ldap_misc.c 2010-03-05 11:03:10.000000000 -0500
|
||||
@@ -2101,6 +2101,22 @@ populate_krb5_db_entry(krb5_context cont
|
||||
goto cleanup;
|
||||
if ((st=krb5_dbe_update_tl_data(context, entry, &userinfo_tl_data)) != 0)
|
||||
@@ -1546,6 +1546,23 @@ populate_krb5_db_entry(krb5_context cont
|
||||
ret = krb5_dbe_update_tl_data(context, entry, &userinfo_tl_data);
|
||||
if (ret)
|
||||
goto cleanup;
|
||||
+#ifdef HAVE_DIRSRV_ACCOUNT_LOCKING
|
||||
+ {
|
||||
@ -33,8 +33,9 @@ diff -up krb5-1.8/src/plugins/kdb/ldap/libkdb_ldap/ldap_misc.c.dirsrv-accountloc
|
||||
+ char *is_login_disabled=NULL;
|
||||
+
|
||||
+ /* LOGIN DISABLED */
|
||||
+ if ((st=krb5_ldap_get_string(ld, ent, "nsAccountLock", &is_login_disabled,
|
||||
+ &attr_present)) != 0)
|
||||
+ ret = krb5_ldap_get_string(ld, ent, "nsAccountLock", &is_login_disabled,
|
||||
+ &attr_present);
|
||||
+ if (ret)
|
||||
+ goto cleanup;
|
||||
+ if (attr_present == TRUE) {
|
||||
+ if (strcasecmp(is_login_disabled, "TRUE")== 0)
|
||||
@ -44,7 +45,8 @@ diff -up krb5-1.8/src/plugins/kdb/ldap/libkdb_ldap/ldap_misc.c.dirsrv-accountloc
|
||||
+ }
|
||||
+#endif
|
||||
|
||||
if ((st=krb5_read_tkt_policy (context, ldap_context, entry, tktpolname)) !=0)
|
||||
ret = krb5_read_tkt_policy(context, ldap_context, entry, tktpolname);
|
||||
if (ret)
|
||||
goto cleanup;
|
||||
diff -up krb5-1.8/src/plugins/kdb/ldap/libkdb_ldap/ldap_principal.c.dirsrv-accountlock krb5-1.8/src/plugins/kdb/ldap/libkdb_ldap/ldap_principal.c
|
||||
--- krb5-1.8/src/plugins/kdb/ldap/libkdb_ldap/ldap_principal.c.dirsrv-accountlock 2009-11-24 18:52:25.000000000 -0500
|
||||
@ -125,10 +125,10 @@ which we used earlier, is some improvement.
|
||||
localedir='$(datadir)/locale'
|
||||
--- krb5/src/include/k5-int.h
|
||||
+++ krb5/src/include/k5-int.h
|
||||
@@ -133,6 +133,7 @@ typedef unsigned char u_char;
|
||||
typedef UINT64_TYPE krb5_ui_8;
|
||||
typedef INT64_TYPE krb5_int64;
|
||||
@@ -129,6 +129,7 @@ typedef unsigned char u_char;
|
||||
|
||||
|
||||
#include "k5-platform.h"
|
||||
+#include "k5-label.h"
|
||||
|
||||
#define KRB5_KDB_MAX_LIFE (60*60*24) /* one day */
|
||||
@ -289,8 +289,8 @@ which we used earlier, is some improvement.
|
||||
--- krb5/src/plugins/kdb/db2/libdb2/btree/bt_open.c
|
||||
+++ krb5/src/plugins/kdb/db2/libdb2/btree/bt_open.c
|
||||
@@ -60,6 +60,7 @@ static char sccsid[] = "@(#)bt_open.c 8.
|
||||
|
||||
#include "k5-platform.h" /* mkstemp? */
|
||||
#include <string.h>
|
||||
#include <unistd.h>
|
||||
|
||||
+#include "k5-int.h"
|
||||
#include "db-int.h"
|
||||
@ -364,7 +364,7 @@ which we used earlier, is some improvement.
|
||||
@@ -437,6 +437,9 @@ void doit(fd)
|
||||
krb5_enctype etype;
|
||||
int database_fd;
|
||||
char host[INET6_ADDRSTRLEN+1];
|
||||
char host[INET6_ADDRSTRLEN + 1];
|
||||
+#ifdef USE_SELINUX
|
||||
+ void *selabel;
|
||||
+#endif
|
||||
@ -379,13 +379,13 @@ which we used earlier, is some improvement.
|
||||
+ selabel = krb5int_push_fscreatecon_for(file);
|
||||
+#endif
|
||||
omask = umask(077);
|
||||
lock_fd = open(temp_file_name, O_RDWR|O_CREAT, 0600);
|
||||
(void) umask(omask);
|
||||
lock_fd = open(temp_file_name, O_RDWR | O_CREAT, 0600);
|
||||
(void)umask(omask);
|
||||
+#ifdef USE_SELINUX
|
||||
+ krb5int_pop_fscreatecon(selabel);
|
||||
+#endif
|
||||
retval = krb5_lock_file(kpropd_context, lock_fd,
|
||||
KRB5_LOCKMODE_EXCLUSIVE|KRB5_LOCKMODE_DONTBLOCK);
|
||||
KRB5_LOCKMODE_EXCLUSIVE | KRB5_LOCKMODE_DONTBLOCK);
|
||||
if (retval) {
|
||||
--- krb5/src/util/profile/prof_file.c
|
||||
+++ krb5/src/util/profile/prof_file.c
|
||||
@ -884,9 +884,9 @@ which we used earlier, is some improvement.
|
||||
+ if (status == 0)
|
||||
+ return 0;
|
||||
+ }
|
||||
krb5_set_error_message(context, KRB5_FCC_NOFILE,
|
||||
_("Credential cache directory %s does not "
|
||||
"exist"), dirname);
|
||||
k5_setmsg(context, KRB5_FCC_NOFILE,
|
||||
_("Credential cache directory %s does not exist"),
|
||||
dirname);
|
||||
--- krb5/src/lib/krb5/os/trace.c
|
||||
+++ krb5/src/lib/krb5/os/trace.c
|
||||
@@ -401,7 +401,7 @@ krb5_set_trace_filename(krb5_context con
|
||||
@ -944,10 +944,10 @@ which we used earlier, is some improvement.
|
||||
pid = (unsigned long) getpid();
|
||||
--- krb5/src/lib/kdb/kdb_log.c
|
||||
+++ krb5/src/lib/kdb/kdb_log.c
|
||||
@@ -566,7 +566,7 @@ ulog_map(krb5_context context, const cha
|
||||
if (caller == FKPROPLOG)
|
||||
return errno;
|
||||
@@ -456,7 +456,7 @@ ulog_map(krb5_context context, const cha
|
||||
int ulogfd = -1;
|
||||
|
||||
if (stat(logname, &st) == -1) {
|
||||
- ulogfd = open(logname, O_RDWR | O_CREAT, 0600);
|
||||
+ ulogfd = THREEPARAMOPEN(logname, O_RDWR | O_CREAT, 0600);
|
||||
if (ulogfd == -1)
|
||||
@ -1,41 +0,0 @@
|
||||
Use mktemp to create our temporary files instead of basing them on our PID.
|
||||
Only portable if you assume the presence of a mktemp helper.
|
||||
diff -ur krb5-1.3.4/src/util/send-pr/send-pr.sh krb5-1.3.4/src/util/send-pr/send-pr.sh
|
||||
--- krb5-1.3.4/src/util/send-pr/send-pr.sh 1997-03-20 01:13:56.000000000 +0100
|
||||
+++ krb5-1.3.4/src/util/send-pr/send-pr.sh 2004-09-20 11:28:56.000000000 +0200
|
||||
@@ -96,9 +96,9 @@
|
||||
fi
|
||||
fi
|
||||
|
||||
-TEMP=$TMPDIR/p$$
|
||||
-BAD=$TMPDIR/pbad$$
|
||||
-REF=$TMPDIR/pf$$
|
||||
+TEMP=`mktemp "$TMPDIR"/p.XXXXXX` || exit 1
|
||||
+BAD=`mktemp "$TMPDIR"/pbad.XXXXXX` || exit 1
|
||||
+REF=`mktemp "$TMPDIR"/pf.XXXXXX` || exit 1
|
||||
|
||||
# find a user name
|
||||
if [ "$LOGNAME" = "" ]; then
|
||||
@@ -122,9 +122,10 @@
|
||||
else
|
||||
# Must use temp file due to incompatibilities in quoting behavior
|
||||
# and to protect shell metacharacters in the expansion of $LOGNAME
|
||||
- $PASSWD | grep "^$LOGNAME:" | awk -F: '{print $5}' | sed -e 's/,.*//' > $TEMP
|
||||
- ORIGINATOR="`cat $TEMP`"
|
||||
- rm -f $TEMP
|
||||
+ TEMP2=`mktemp "$TMPDIR"/plogname.XXXXXX` || exit 1
|
||||
+ $PASSWD | grep "^$LOGNAME:" | awk -F: '{print $5}' | sed -e 's/,.*//' > $TEMP2
|
||||
+ ORIGINATOR="`cat $TEMP2`"
|
||||
+ rm -f $TEMP2
|
||||
fi
|
||||
|
||||
if [ -n "$ORGANIZATION" ]; then
|
||||
@@ -280,7 +281,7 @@
|
||||
# Catch some signals. ($xs kludge needed by Sun /bin/sh)
|
||||
xs=0
|
||||
trap 'rm -f $REF $TEMP; exit $xs' 0
|
||||
-trap 'echo "$COMMAND: Aborting ..."; rm -f $REF $TEMP; xs=1; exit' 1 2 3 13 15
|
||||
+trap 'echo "$COMMAND: Aborting ..."; rm -f "$REF" "$BAD" "$TEMP"; xs=1; exit' 1 2 3 13 15
|
||||
|
||||
# If they told us to use a specific file, then do so.
|
||||
if [ -n "$IN_FILE" ]; then
|
||||
@ -1,41 +0,0 @@
|
||||
commit 5ac159e220297a8f62dd5edcec6f9b988b0627ea
|
||||
Author: Nalin Dahyabhai <nalin@dahyabhai.net>
|
||||
Date: Mon Nov 11 13:10:08 2013 -0500
|
||||
|
||||
Catch more strtol() failures when using KEYRINGs
|
||||
|
||||
When parsing what should be a UID while resolving a KEYRING ccache
|
||||
name, don't just depend on strtol() to set errno when the residual
|
||||
that we pass to it can't be parsed as a number. In addition to
|
||||
checking errno, pass in and check the value of an "endptr".
|
||||
|
||||
[ghudson@mit.edu: simplified slightly]
|
||||
|
||||
ticket: 7764 (new)
|
||||
target_version: 1.12
|
||||
tags: pullup
|
||||
|
||||
diff --git a/src/lib/krb5/ccache/cc_keyring.c b/src/lib/krb5/ccache/cc_keyring.c
|
||||
index 795ccd6..a07a0dc 100644
|
||||
--- a/src/lib/krb5/ccache/cc_keyring.c
|
||||
+++ b/src/lib/krb5/ccache/cc_keyring.c
|
||||
@@ -593,7 +593,7 @@ get_collection(const char *anchor_name, const char *collection_name,
|
||||
{
|
||||
krb5_error_code ret;
|
||||
key_serial_t persistent_id, anchor_id, possess_id = 0;
|
||||
- char *ckname;
|
||||
+ char *ckname, *cnend;
|
||||
long uidnum;
|
||||
|
||||
*collection_id_out = 0;
|
||||
@@ -607,8 +607,8 @@ get_collection(const char *anchor_name, const char *collection_name,
|
||||
*/
|
||||
if (*collection_name != '\0') {
|
||||
errno = 0;
|
||||
- uidnum = strtol(collection_name, NULL, 10);
|
||||
- if (errno)
|
||||
+ uidnum = strtol(collection_name, &cnend, 10);
|
||||
+ if (errno || *cnend != '\0')
|
||||
return KRB5_KCC_INVALID_UID;
|
||||
} else {
|
||||
uidnum = geteuid();
|
||||
@ -1,275 +0,0 @@
|
||||
commit 123c14fd8862ee8f11f6084d25958cb380655f35
|
||||
Author: Günther Deschner <gdeschner@redhat.com>
|
||||
Date: Wed Mar 5 16:21:55 2014 +0100
|
||||
|
||||
Remove dead code from the mechglue initialization
|
||||
|
||||
The stat check in gss_indicate_mechs had no consequent and would have
|
||||
been redundant with logic in updateMechList if it did.
|
||||
|
||||
[ghudson@mit.edu: elaborated commit message; removed unused
|
||||
g_mechSetTime and now-irrelevant comment]
|
||||
|
||||
diff --git a/src/lib/gssapi/mechglue/g_initialize.c b/src/lib/gssapi/mechglue/g_initialize.c
|
||||
index 48a825e..c6904e0 100644
|
||||
--- a/src/lib/gssapi/mechglue/g_initialize.c
|
||||
+++ b/src/lib/gssapi/mechglue/g_initialize.c
|
||||
@@ -91,7 +91,6 @@ static gss_mech_info g_mechListTail = NULL;
|
||||
static k5_mutex_t g_mechListLock = K5_MUTEX_PARTIAL_INITIALIZER;
|
||||
static time_t g_confFileModTime = (time_t)0;
|
||||
|
||||
-static time_t g_mechSetTime = (time_t)0;
|
||||
static gss_OID_set_desc g_mechSet = { 0, NULL };
|
||||
static k5_mutex_t g_mechSetLock = K5_MUTEX_PARTIAL_INITIALIZER;
|
||||
|
||||
@@ -213,8 +212,6 @@ gss_indicate_mechs(minorStatus, mechSet_out)
|
||||
OM_uint32 *minorStatus;
|
||||
gss_OID_set *mechSet_out;
|
||||
{
|
||||
- char *fileName;
|
||||
- struct stat fileInfo;
|
||||
OM_uint32 status;
|
||||
|
||||
/* Initialize outputs. */
|
||||
@@ -233,16 +230,6 @@ gss_OID_set *mechSet_out;
|
||||
if (*minorStatus != 0)
|
||||
return (GSS_S_FAILURE);
|
||||
|
||||
- fileName = MECH_CONF;
|
||||
-
|
||||
- /*
|
||||
- * If we have already computed the mechanisms supported and if it
|
||||
- * is still valid; make a copy and return to caller,
|
||||
- * otherwise build it first.
|
||||
- */
|
||||
- if ((stat(fileName, &fileInfo) == 0 &&
|
||||
- fileInfo.st_mtime > g_mechSetTime)) {
|
||||
- } /* if g_mechSet is out of date or not initialized */
|
||||
if (build_mechSet())
|
||||
return GSS_S_FAILURE;
|
||||
|
||||
@@ -289,20 +276,6 @@ build_mechSet(void)
|
||||
*/
|
||||
k5_mutex_lock(&g_mechListLock);
|
||||
|
||||
-#if 0
|
||||
- /*
|
||||
- * this checks for the case when we need to re-construct the
|
||||
- * g_mechSet structure, but the mechanism list is upto date
|
||||
- * (because it has been read by someone calling
|
||||
- * gssint_get_mechanism)
|
||||
- */
|
||||
- if (fileInfo.st_mtime > g_confFileModTime)
|
||||
- {
|
||||
- g_confFileModTime = fileInfo.st_mtime;
|
||||
- loadConfigFile(fileName);
|
||||
- }
|
||||
-#endif
|
||||
-
|
||||
updateMechList();
|
||||
|
||||
/*
|
||||
|
||||
commit 05cbef80d53f49d30a5d0563501226dc173734d4
|
||||
Author: Günther Deschner <gdeschner@redhat.com>
|
||||
Date: Wed Mar 5 15:25:43 2014 +0100
|
||||
|
||||
Load mechglue config files from /etc/gss/mech.d
|
||||
|
||||
In addition to loading /etc/gss/mech, glob for *.conf files in
|
||||
/etc/gss/mech.d. Load only config files which have changed since the
|
||||
highest mtime we saw in the previous scan. Scan at most once per
|
||||
second to avoid excessive numbers of filesystem syscalls for busy
|
||||
GSSAPI applications.
|
||||
|
||||
[ghudson@mit.edu: rewrote commit message; style changes; added
|
||||
once-per-second throttle on glob/stat calls]
|
||||
|
||||
ticket: 7882 (new)
|
||||
|
||||
diff --git a/src/lib/gssapi/mechglue/g_initialize.c b/src/lib/gssapi/mechglue/g_initialize.c
|
||||
index c6904e0..f0acf1a 100644
|
||||
--- a/src/lib/gssapi/mechglue/g_initialize.c
|
||||
+++ b/src/lib/gssapi/mechglue/g_initialize.c
|
||||
@@ -41,6 +41,7 @@
|
||||
#include <string.h>
|
||||
#include <ctype.h>
|
||||
#include <errno.h>
|
||||
+#include <glob.h>
|
||||
|
||||
#define M_DEFAULT "default"
|
||||
|
||||
@@ -58,6 +59,7 @@
|
||||
#ifndef MECH_CONF
|
||||
#define MECH_CONF "/etc/gss/mech"
|
||||
#endif
|
||||
+#define MECH_CONF_PATTERN MECH_CONF ".d/*.conf"
|
||||
|
||||
/* Local functions */
|
||||
static void addConfigEntry(const char *oidStr, const char *oid,
|
||||
@@ -90,6 +92,7 @@ static gss_mech_info g_mechList = NULL;
|
||||
static gss_mech_info g_mechListTail = NULL;
|
||||
static k5_mutex_t g_mechListLock = K5_MUTEX_PARTIAL_INITIALIZER;
|
||||
static time_t g_confFileModTime = (time_t)0;
|
||||
+static time_t g_confLastCall = (time_t)0;
|
||||
|
||||
static gss_OID_set_desc g_mechSet = { 0, NULL };
|
||||
static k5_mutex_t g_mechSetLock = K5_MUTEX_PARTIAL_INITIALIZER;
|
||||
@@ -383,6 +386,56 @@ const gss_OID oid;
|
||||
return (modOptions);
|
||||
} /* gssint_get_modOptions */
|
||||
|
||||
+/* Return the mtime of filename or its eventual symlink target (if it is a
|
||||
+ * symlink), whichever is larger. Return (time_t)-1 if lstat or stat fails. */
|
||||
+static time_t
|
||||
+check_link_mtime(const char *filename, time_t *mtime_out)
|
||||
+{
|
||||
+ struct stat st1, st2;
|
||||
+
|
||||
+ if (lstat(filename, &st1) != 0)
|
||||
+ return (time_t)-1;
|
||||
+ if (!S_ISLNK(st1.st_mode))
|
||||
+ return st1.st_mtime;
|
||||
+ if (stat(filename, &st2) != 0)
|
||||
+ return (time_t)-1;
|
||||
+ return (st1.st_mtime > st2.st_mtime) ? st1.st_mtime : st2.st_mtime;
|
||||
+}
|
||||
+
|
||||
+/* Try to load any config files which have changed since the last call. Config
|
||||
+ * files are MECH_CONF and any files matching MECH_CONF_PATTERN. */
|
||||
+static void
|
||||
+loadConfigFiles()
|
||||
+{
|
||||
+ glob_t globbuf;
|
||||
+ time_t highest_mtime = 0, mtime, now;
|
||||
+ char **pathptr;
|
||||
+
|
||||
+ /* Don't glob and stat more than once per second. */
|
||||
+ if (time(&now) == (time_t)-1 || now == g_confLastCall)
|
||||
+ return;
|
||||
+ g_confLastCall = now;
|
||||
+
|
||||
+ globbuf.gl_offs = 1;
|
||||
+ if (glob(MECH_CONF_PATTERN, GLOB_DOOFFS, NULL, &globbuf) != 0)
|
||||
+ return;
|
||||
+ globbuf.gl_pathv[0] = MECH_CONF;
|
||||
+
|
||||
+ for (pathptr = globbuf.gl_pathv; *pathptr != NULL; pathptr++) {
|
||||
+ mtime = check_link_mtime(*pathptr, &mtime);
|
||||
+ if (mtime == (time_t)-1)
|
||||
+ continue;
|
||||
+ if (mtime > highest_mtime)
|
||||
+ highest_mtime = mtime;
|
||||
+ if (mtime > g_confFileModTime)
|
||||
+ loadConfigFile(*pathptr);
|
||||
+ }
|
||||
+ g_confFileModTime = highest_mtime;
|
||||
+
|
||||
+ globbuf.gl_pathv[0] = NULL;
|
||||
+ globfree(&globbuf);
|
||||
+}
|
||||
+
|
||||
/*
|
||||
* determines if the mechList needs to be updated from file
|
||||
* and performs the update.
|
||||
@@ -401,17 +454,7 @@ updateMechList(void)
|
||||
loadConfigFromRegistry(HKEY_CURRENT_USER, MECH_KEY);
|
||||
loadConfigFromRegistry(HKEY_LOCAL_MACHINE, MECH_KEY);
|
||||
#else /* _WIN32 */
|
||||
- char *fileName;
|
||||
- struct stat fileInfo;
|
||||
-
|
||||
- fileName = MECH_CONF;
|
||||
-
|
||||
- /* check if mechList needs updating */
|
||||
- if (stat(fileName, &fileInfo) != 0 ||
|
||||
- g_confFileModTime >= fileInfo.st_mtime)
|
||||
- return;
|
||||
- g_confFileModTime = fileInfo.st_mtime;
|
||||
- loadConfigFile(fileName);
|
||||
+ loadConfigFiles();
|
||||
#endif /* !_WIN32 */
|
||||
|
||||
/* Load any unloaded interposer mechanisms immediately, to make sure we
|
||||
|
||||
commit ac98187641f6943ae571606c0b6a97f236f9b60c
|
||||
Author: Greg Hudson <ghudson@mit.edu>
|
||||
Date: Wed May 28 23:51:49 2014 -0400
|
||||
|
||||
Read /etc/gss/mech if no mech.d/*.conf found
|
||||
|
||||
Always read /etc/gss/mech, even if globbing /etc/gss/mech.d/*.conf
|
||||
doesn't work. Doing this using GLOB_DOOFFS proved error-prone, so use
|
||||
a simpler approach: factor out the per-pathname handling into a helper
|
||||
function load_if_changed, call it with MECH_CONF before the glob, then
|
||||
pass each glob result through the helper.
|
||||
|
||||
ticket: 7925
|
||||
|
||||
diff --git a/src/lib/gssapi/mechglue/g_initialize.c b/src/lib/gssapi/mechglue/g_initialize.c
|
||||
index f0acf1a..8bce14c 100644
|
||||
--- a/src/lib/gssapi/mechglue/g_initialize.c
|
||||
+++ b/src/lib/gssapi/mechglue/g_initialize.c
|
||||
@@ -402,38 +402,45 @@ check_link_mtime(const char *filename, time_t *mtime_out)
|
||||
return (st1.st_mtime > st2.st_mtime) ? st1.st_mtime : st2.st_mtime;
|
||||
}
|
||||
|
||||
+/* Load pathname if it is newer than last. Update *highest to the maximum of
|
||||
+ * its current value and pathname's mod time. */
|
||||
+static void
|
||||
+load_if_changed(const char *pathname, time_t last, time_t *highest)
|
||||
+{
|
||||
+ time_t mtime;
|
||||
+
|
||||
+ mtime = check_link_mtime(pathname, &mtime);
|
||||
+ if (mtime == (time_t)-1)
|
||||
+ return;
|
||||
+ if (mtime > *highest)
|
||||
+ *highest = mtime;
|
||||
+ if (mtime > last)
|
||||
+ loadConfigFile(pathname);
|
||||
+}
|
||||
+
|
||||
/* Try to load any config files which have changed since the last call. Config
|
||||
* files are MECH_CONF and any files matching MECH_CONF_PATTERN. */
|
||||
static void
|
||||
loadConfigFiles()
|
||||
{
|
||||
glob_t globbuf;
|
||||
- time_t highest_mtime = 0, mtime, now;
|
||||
- char **pathptr;
|
||||
+ time_t highest = 0, now;
|
||||
+ char **path;
|
||||
|
||||
/* Don't glob and stat more than once per second. */
|
||||
if (time(&now) == (time_t)-1 || now == g_confLastCall)
|
||||
return;
|
||||
g_confLastCall = now;
|
||||
|
||||
- globbuf.gl_offs = 1;
|
||||
- if (glob(MECH_CONF_PATTERN, GLOB_DOOFFS, NULL, &globbuf) != 0)
|
||||
- return;
|
||||
- globbuf.gl_pathv[0] = MECH_CONF;
|
||||
+ load_if_changed(MECH_CONF, g_confFileModTime, &highest);
|
||||
|
||||
- for (pathptr = globbuf.gl_pathv; *pathptr != NULL; pathptr++) {
|
||||
- mtime = check_link_mtime(*pathptr, &mtime);
|
||||
- if (mtime == (time_t)-1)
|
||||
- continue;
|
||||
- if (mtime > highest_mtime)
|
||||
- highest_mtime = mtime;
|
||||
- if (mtime > g_confFileModTime)
|
||||
- loadConfigFile(*pathptr);
|
||||
+ if (glob(MECH_CONF_PATTERN, 0, NULL, &globbuf) == 0) {
|
||||
+ for (path = globbuf.gl_pathv; *path != NULL; path++)
|
||||
+ load_if_changed(*path, g_confFileModTime, &highest);
|
||||
+ globfree(&globbuf);
|
||||
}
|
||||
- g_confFileModTime = highest_mtime;
|
||||
|
||||
- globbuf.gl_pathv[0] = NULL;
|
||||
- globfree(&globbuf);
|
||||
+ g_confFileModTime = highest;
|
||||
}
|
||||
|
||||
/*
|
||||
@ -1,203 +0,0 @@
|
||||
Adjusted to apply to 1.12.2.
|
||||
|
||||
commit 1e4bdcfed2c7bda94d5c135cc32a5993ca032501
|
||||
Author: Nathaniel McCallum <npmccallum@redhat.com>
|
||||
Date: Wed Feb 5 10:59:46 2014 -0500
|
||||
|
||||
Move OTP sockets to KDC_RUN_DIR
|
||||
|
||||
Some system configurations expect Unix-domain sockets to live under
|
||||
/run or /var/run, and not other parts of /var where persistent
|
||||
application state lives. Define a new directory KDC_RUN_DIR using
|
||||
$runstatedir (new in autoconf 2.70, so fall back to $localstatedir/run
|
||||
if it's not set) and use that for the default socket path.
|
||||
|
||||
[ghudson@mit.edu: commit message, otp.rst formatting fix]
|
||||
|
||||
ticket: 7859 (new)
|
||||
|
||||
diff --git a/doc/admin/otp.rst b/doc/admin/otp.rst
|
||||
index 0abd5ff..f12c36d 100644
|
||||
--- a/doc/admin/otp.rst
|
||||
+++ b/doc/admin/otp.rst
|
||||
@@ -23,7 +23,7 @@ the following format::
|
||||
|
||||
[otp]
|
||||
<name> = {
|
||||
- server = <host:port or filename> (default: $KDCDIR/<name>.socket)
|
||||
+ server = <host:port or filename> (default: see below)
|
||||
secret = <filename>
|
||||
timeout = <integer> (default: 5 [seconds])
|
||||
retries = <integer> (default: 3)
|
||||
@@ -33,7 +33,8 @@ the following format::
|
||||
If the server field begins with '/', it will be interpreted as a UNIX
|
||||
socket. Otherwise, it is assumed to be in the format host:port. When
|
||||
a UNIX domain socket is specified, the secret field is optional and an
|
||||
-empty secret is used by default.
|
||||
+empty secret is used by default. If the server field is not
|
||||
+specified, it defaults to |kdcrundir|\ ``/<name>.socket``.
|
||||
|
||||
When forwarding the request over RADIUS, by default the principal is
|
||||
used in the User-Name attribute of the RADIUS packet. The strip_realm
|
||||
diff --git a/doc/conf.py b/doc/conf.py
|
||||
index f015fc8..bc8b2bd 100644
|
||||
--- a/doc/conf.py
|
||||
+++ b/doc/conf.py
|
||||
@@ -231,6 +231,7 @@ if 'mansubs' in tags:
|
||||
sbindir = '``@SBINDIR@``'
|
||||
libdir = '``@LIBDIR@``'
|
||||
localstatedir = '``@LOCALSTATEDIR@``'
|
||||
+ runstatedir = '``@RUNSTATEDIR@``'
|
||||
sysconfdir = '``@SYSCONFDIR@``'
|
||||
ccache = '``@CCNAME@``'
|
||||
keytab = '``@KTNAME@``'
|
||||
@@ -243,6 +244,7 @@ else:
|
||||
sbindir = ':ref:`SBINDIR <paths>`'
|
||||
libdir = ':ref:`LIBDIR <paths>`'
|
||||
localstatedir = ':ref:`LOCALSTATEDIR <paths>`'
|
||||
+ runstatedir = ':ref:`RUNSTATEDIR <paths>`'
|
||||
sysconfdir = ':ref:`SYSCONFDIR <paths>`'
|
||||
ccache = ':ref:`DEFCCNAME <paths>`'
|
||||
keytab = ':ref:`DEFKTNAME <paths>`'
|
||||
@@ -262,6 +264,7 @@ else:
|
||||
rst_epilog += '.. |sbindir| replace:: %s\n' % sbindir
|
||||
rst_epilog += '.. |libdir| replace:: %s\n' % libdir
|
||||
rst_epilog += '.. |kdcdir| replace:: %s\\ ``/krb5kdc``\n' % localstatedir
|
||||
+ rst_epilog += '.. |kdcrundir| replace:: %s\\ ``/krb5kdc``\n' % runstatedir
|
||||
rst_epilog += '.. |sysconfdir| replace:: %s\n' % sysconfdir
|
||||
rst_epilog += '.. |ccache| replace:: %s\n' % ccache
|
||||
rst_epilog += '.. |keytab| replace:: %s\n' % keytab
|
||||
diff --git a/doc/mitK5defaults.rst b/doc/mitK5defaults.rst
|
||||
index 89b8f4c..838dabb 100644
|
||||
--- a/doc/mitK5defaults.rst
|
||||
+++ b/doc/mitK5defaults.rst
|
||||
@@ -17,6 +17,7 @@ KDC config file :ref:`kdc.conf(5)` |kdcdir|\ ``/kdc.conf`` **KRB
|
||||
KDC database path (DB2) |kdcdir|\ ``/principal``
|
||||
Master key :ref:`stash_definition` |kdcdir|\ ``/.k5.``\ *realm*
|
||||
Admin server ACL file :ref:`kadm5.acl(5)` |kdcdir|\ ``/kadm5.acl``
|
||||
+OTP socket directory |kdcrundir|
|
||||
Plugin base directory |libdir|\ ``/krb5/plugins``
|
||||
:ref:`rcache_definition` directory ``/var/tmp`` **KRB5RCACHEDIR**
|
||||
Master key default enctype |defmkey|
|
||||
@@ -64,6 +65,7 @@ Description Symbolic name Custom build path Typical
|
||||
User programs BINDIR ``/usr/local/bin`` ``/usr/bin``
|
||||
Libraries and plugins LIBDIR ``/usr/local/lib`` ``/usr/lib``
|
||||
Parent of KDC state dir LOCALSTATEDIR ``/usr/local/var`` ``/var``
|
||||
+Parent of KDC runtime dir RUNSTATEDIR ``/usr/local/var/run`` ``/run``
|
||||
Administrative programs SBINDIR ``/usr/local/sbin`` ``/usr/sbin``
|
||||
Alternate krb5.conf dir SYSCONFDIR ``/usr/local/etc`` ``/etc``
|
||||
Default ccache name DEFCCNAME ``FILE:/tmp/krb5cc_%{uid}`` ``FILE:/tmp/krb5cc_%{uid}``
|
||||
diff --git a/src/Makefile.in b/src/Makefile.in
|
||||
index a8bc990..1725093 100644
|
||||
--- a/src/Makefile.in
|
||||
+++ b/src/Makefile.in
|
||||
@@ -64,6 +64,7 @@ INSTALLMKDIRS = $(KRB5ROOT) $(KRB5MANROOT) $(KRB5OTHERMKDIRS) \
|
||||
$(KRB5_AD_MODULE_DIR) \
|
||||
$(KRB5_LIBKRB5_MODULE_DIR) \
|
||||
@localstatedir@ @localstatedir@/krb5kdc \
|
||||
+ @runstatedir@ @runstatedir@/krb5kdc \
|
||||
$(KRB5_INCSUBDIRS) $(datadir) $(EXAMPLEDIR) \
|
||||
$(PKGCONFIG_DIR)
|
||||
|
||||
diff --git a/src/configure.in b/src/configure.in
|
||||
index 2145d54..c2eaf78 100644
|
||||
--- a/src/configure.in
|
||||
+++ b/src/configure.in
|
||||
@@ -9,6 +9,12 @@
|
||||
fi
|
||||
AC_SUBST(SYSCONFCONF)
|
||||
|
||||
+# If $runstatedir isn't set by autoconf (<2.70), set it manually.
|
||||
+if test x"$runstatedir" == x; then
|
||||
+ runstatedir=$localstatedir/run
|
||||
+fi
|
||||
+AC_SUBST(runstatedir)
|
||||
+
|
||||
CONFIG_RULES
|
||||
KRB5_VERSION=K5_VERSION
|
||||
AC_SUBST(KRB5_VERSION)
|
||||
diff --git a/src/doc/Makefile.in b/src/doc/Makefile.in
|
||||
index a6bb7c5..b07e16a 100644
|
||||
--- a/src/doc/Makefile.in
|
||||
+++ b/src/doc/Makefile.in
|
||||
@@ -7,6 +7,7 @@ DOXYGEN=doxygen
|
||||
|
||||
docsrc=$(top_srcdir)/../doc
|
||||
localstatedir=@localstatedir@
|
||||
+runstatedir=@runstatedir@
|
||||
sysconfdir=@sysconfdir@
|
||||
DEFCCNAME=@DEFCCNAME@
|
||||
DEFKTNAME=@DEFKTNAME@
|
||||
@@ -113,6 +114,7 @@ paths.py:
|
||||
echo 'sbindir = "``$(SERVER_BINDIR)``"' >> $@
|
||||
echo 'libdir = "``$(KRB5_LIBDIR)``"' >> $@
|
||||
echo 'localstatedir = "``$(localstatedir)``"' >> $@
|
||||
+ echo 'runstatedir = "``$(runstatedir)``"' >> $@
|
||||
echo 'sysconfdir = "``$(sysconfdir)``"' >> $@
|
||||
echo 'ccache = "``$(DEFCCNAME)``"' >> $@
|
||||
echo 'keytab = "``$(DEFKTNAME)``"' >> $@
|
||||
diff --git a/src/include/Makefile.in b/src/include/Makefile.in
|
||||
index e13042a..f83ff4e 100644
|
||||
--- a/src/include/Makefile.in
|
||||
+++ b/src/include/Makefile.in
|
||||
@@ -53,6 +53,7 @@ autoconf.stamp: $(srcdir)/autoconf.h.in $(BUILDTOP)/config.status
|
||||
|
||||
SYSCONFDIR = @sysconfdir@
|
||||
LOCALSTATEDIR = @localstatedir@
|
||||
+RUNSTATEDIR = @runstatedir@
|
||||
BINDIR = @bindir@
|
||||
SBINDIR = @sbindir@
|
||||
LIBDIR = @libdir@
|
||||
@@ -66,6 +67,7 @@ PROCESS_REPLACE = -e "s+@KRB5RCTMPDIR+$(KRB5RCTMPDIR)+" \
|
||||
-e "s+@MODULEDIR+$(MODULE_DIR)+" \
|
||||
-e "s+@GSSMODULEDIR+$(GSS_MODULE_DIR)+" \
|
||||
-e 's+@LOCALSTATEDIR+$(LOCALSTATEDIR)+' \
|
||||
+ -e 's+@RUNSTATEDIR+$(RUNSTATEDIR)+' \
|
||||
-e 's+@SYSCONFDIR+$(SYSCONFDIR)+' \
|
||||
-e 's+@DYNOBJEXT+$(DYNOBJEXT)+' \
|
||||
-e 's+@SYSCONFCONF+$(SYSCONFCONF)+'
|
||||
diff --git a/src/include/osconf.hin b/src/include/osconf.hin
|
||||
index 90ab86d..871503a 100644
|
||||
--- a/src/include/osconf.hin
|
||||
+++ b/src/include/osconf.hin
|
||||
@@ -59,6 +59,7 @@
|
||||
#define PLUGIN_EXT "@DYNOBJEXT"
|
||||
|
||||
#define KDC_DIR "@LOCALSTATEDIR/krb5kdc"
|
||||
+#define KDC_RUN_DIR "@RUNSTATEDIR/krb5kdc"
|
||||
#define DEFAULT_KDB_FILE KDC_DIR "/principal"
|
||||
#define DEFAULT_KEYFILE_STUB KDC_DIR "/.k5."
|
||||
#define KRB5_DEFAULT_ADMIN_ACL KDC_DIR "/krb5_adm.acl"
|
||||
diff --git a/src/man/Makefile.in b/src/man/Makefile.in
|
||||
index 4dd2448..2b9c892 100644
|
||||
--- a/src/man/Makefile.in
|
||||
+++ b/src/man/Makefile.in
|
||||
@@ -5,6 +5,7 @@ SPHINX_BUILD=sphinx-build
|
||||
GROFF=@GROFF@
|
||||
GROFF_MAN=$(GROFF) -mtty-char -Tascii -mandoc -c
|
||||
localstatedir=@localstatedir@
|
||||
+runstatedir=@runstatedir@
|
||||
sysconfdir=@sysconfdir@
|
||||
DEFCCNAME=@DEFCCNAME@
|
||||
DEFKTNAME=@DEFKTNAME@
|
||||
@@ -44,6 +45,7 @@ $(docsrc)/version.py: $(top_srcdir)/patchlevel.h
|
||||
-e 's|@SBINDIR@|$(SERVER_BINDIR)|g' \
|
||||
-e 's|@LIBDIR@|$(KRB5_LIBDIR)|g' \
|
||||
-e 's|@LOCALSTATEDIR@|$(localstatedir)|g' \
|
||||
+ -e 's|@RUNSTATEDIR@|$(runstatedir)|g' \
|
||||
-e 's|@SYSCONFDIR@|$(sysconfdir)|g' \
|
||||
-e 's|@CCNAME@|$(DEFCCNAME)|g' \
|
||||
-e 's|@KTNAME@|$(DEFKTNAME)|g' \
|
||||
diff --git a/src/plugins/preauth/otp/otp_state.c b/src/plugins/preauth/otp/otp_state.c
|
||||
index a4d7e3b..4643dff 100644
|
||||
--- a/src/plugins/preauth/otp/otp_state.c
|
||||
+++ b/src/plugins/preauth/otp/otp_state.c
|
||||
@@ -40,7 +40,7 @@
|
||||
#endif
|
||||
|
||||
#define DEFAULT_TYPE_NAME "DEFAULT"
|
||||
-#define DEFAULT_SOCKET_FMT KDC_DIR "/%s.socket"
|
||||
+#define DEFAULT_SOCKET_FMT KDC_RUN_DIR "/%s.socket"
|
||||
#define DEFAULT_TIMEOUT 5
|
||||
#define DEFAULT_RETRIES 3
|
||||
#define MAX_SECRET_LEN 1024
|
||||
@ -1,105 +0,0 @@
|
||||
commit ef8e19af863158e4c1abc15fc710aa8cfad38406
|
||||
Author: Greg Hudson <ghudson@mit.edu>
|
||||
Date: Wed Jan 15 12:51:42 2014 -0500
|
||||
|
||||
Clean up GSS krb5 acquire_accept_cred
|
||||
|
||||
Use a cleanup handler instead of releasing kt in multiple error
|
||||
clauses. Wrap a long line and fix a comment with a missing word.
|
||||
Rewrap the function arguments to use fewer lines.
|
||||
|
||||
diff --git a/src/lib/gssapi/krb5/acquire_cred.c b/src/lib/gssapi/krb5/acquire_cred.c
|
||||
index 9547207..37cc6b5 100644
|
||||
--- a/src/lib/gssapi/krb5/acquire_cred.c
|
||||
+++ b/src/lib/gssapi/krb5/acquire_cred.c
|
||||
@@ -179,13 +179,13 @@ cleanup:
|
||||
*/
|
||||
|
||||
static OM_uint32
|
||||
-acquire_accept_cred(krb5_context context,
|
||||
- OM_uint32 *minor_status,
|
||||
- krb5_keytab req_keytab,
|
||||
- krb5_gss_cred_id_rec *cred)
|
||||
+acquire_accept_cred(krb5_context context, OM_uint32 *minor_status,
|
||||
+ krb5_keytab req_keytab, krb5_gss_cred_id_rec *cred)
|
||||
{
|
||||
+ OM_uint32 major;
|
||||
krb5_error_code code;
|
||||
- krb5_keytab kt;
|
||||
+ krb5_keytab kt = NULL;
|
||||
+ krb5_rcache rc = NULL;
|
||||
|
||||
assert(cred->keytab == NULL);
|
||||
|
||||
@@ -202,46 +202,54 @@ acquire_accept_cred(krb5_context context,
|
||||
}
|
||||
}
|
||||
if (code) {
|
||||
- *minor_status = code;
|
||||
- return GSS_S_CRED_UNAVAIL;
|
||||
+ major = GSS_S_CRED_UNAVAIL;
|
||||
+ goto cleanup;
|
||||
}
|
||||
|
||||
if (cred->name != NULL) {
|
||||
- /* Make sure we keys matching the desired name in the keytab. */
|
||||
+ /* Make sure we have keys matching the desired name in the keytab. */
|
||||
code = check_keytab(context, kt, cred->name);
|
||||
if (code) {
|
||||
- krb5_kt_close(context, kt);
|
||||
if (code == KRB5_KT_NOTFOUND) {
|
||||
char *errstr = (char *)krb5_get_error_message(context, code);
|
||||
- krb5_set_error_message(context, KG_KEYTAB_NOMATCH, "%s", errstr);
|
||||
+ krb5_set_error_message(context, KG_KEYTAB_NOMATCH, "%s",
|
||||
+ errstr);
|
||||
krb5_free_error_message(context, errstr);
|
||||
- *minor_status = KG_KEYTAB_NOMATCH;
|
||||
- } else
|
||||
- *minor_status = code;
|
||||
- return GSS_S_CRED_UNAVAIL;
|
||||
+ code = KG_KEYTAB_NOMATCH;
|
||||
+ }
|
||||
+ major = GSS_S_CRED_UNAVAIL;
|
||||
+ goto cleanup;
|
||||
}
|
||||
|
||||
/* Open the replay cache for this principal. */
|
||||
code = krb5_get_server_rcache(context, &cred->name->princ->data[0],
|
||||
- &cred->rcache);
|
||||
+ &rc);
|
||||
if (code) {
|
||||
- krb5_kt_close(context, kt);
|
||||
- *minor_status = code;
|
||||
- return GSS_S_FAILURE;
|
||||
+ major = GSS_S_FAILURE;
|
||||
+ goto cleanup;
|
||||
}
|
||||
} else {
|
||||
/* Make sure we have a keytab with keys in it. */
|
||||
code = krb5_kt_have_content(context, kt);
|
||||
if (code) {
|
||||
- krb5_kt_close(context, kt);
|
||||
- *minor_status = code;
|
||||
- return GSS_S_CRED_UNAVAIL;
|
||||
+ major = GSS_S_CRED_UNAVAIL;
|
||||
+ goto cleanup;
|
||||
}
|
||||
}
|
||||
|
||||
cred->keytab = kt;
|
||||
+ kt = NULL;
|
||||
+ cred->rcache = rc;
|
||||
+ rc = NULL;
|
||||
+ major = GSS_S_COMPLETE;
|
||||
|
||||
- return GSS_S_COMPLETE;
|
||||
+cleanup:
|
||||
+ if (kt != NULL)
|
||||
+ krb5_kt_close(context, kt);
|
||||
+ if (rc != NULL)
|
||||
+ krb5_rc_close(context, rc);
|
||||
+ *minor_status = code;
|
||||
+ return major;
|
||||
}
|
||||
#endif /* LEAN_CLIENT */
|
||||
|
||||
@ -1,136 +0,0 @@
|
||||
commit 7dad0bee30fbbde8cfc0eacd2d1487c198a004a1
|
||||
Author: Simo Sorce <simo@redhat.com>
|
||||
Date: Thu Dec 26 19:05:34 2013 -0500
|
||||
|
||||
Add rcache feature to gss_acquire_cred_from
|
||||
|
||||
The "rcache" cred store entry can specify a replay cache type and name
|
||||
to be used with the credentials being acquired.
|
||||
|
||||
[ghudson@mit.edu: split up, simplified, and altered to fit preparatory
|
||||
commits]
|
||||
|
||||
ticket: 7819 (new)
|
||||
|
||||
diff --git a/src/lib/gssapi/krb5/acquire_cred.c b/src/lib/gssapi/krb5/acquire_cred.c
|
||||
index f625c0c..5d680f9 100644
|
||||
--- a/src/lib/gssapi/krb5/acquire_cred.c
|
||||
+++ b/src/lib/gssapi/krb5/acquire_cred.c
|
||||
@@ -180,7 +180,8 @@ cleanup:
|
||||
|
||||
static OM_uint32
|
||||
acquire_accept_cred(krb5_context context, OM_uint32 *minor_status,
|
||||
- krb5_keytab req_keytab, krb5_gss_cred_id_rec *cred)
|
||||
+ krb5_keytab req_keytab, const char *rcname,
|
||||
+ krb5_gss_cred_id_rec *cred)
|
||||
{
|
||||
OM_uint32 major;
|
||||
krb5_error_code code;
|
||||
@@ -189,6 +190,20 @@ acquire_accept_cred(krb5_context context, OM_uint32 *minor_status,
|
||||
|
||||
assert(cred->keytab == NULL);
|
||||
|
||||
+ /* If we have an explicit rcache name, open it. */
|
||||
+ if (rcname != NULL) {
|
||||
+ code = krb5_rc_resolve_full(context, &rc, rcname);
|
||||
+ if (code) {
|
||||
+ major = GSS_S_FAILURE;
|
||||
+ goto cleanup;
|
||||
+ }
|
||||
+ code = krb5_rc_recover_or_initialize(context, rc, context->clockskew);
|
||||
+ if (code) {
|
||||
+ major = GSS_S_FAILURE;
|
||||
+ goto cleanup;
|
||||
+ }
|
||||
+ }
|
||||
+
|
||||
if (req_keytab != NULL) {
|
||||
code = krb5_kt_dup(context, req_keytab, &kt);
|
||||
} else {
|
||||
@@ -221,12 +236,14 @@ acquire_accept_cred(krb5_context context, OM_uint32 *minor_status,
|
||||
goto cleanup;
|
||||
}
|
||||
|
||||
- /* Open the replay cache for this principal. */
|
||||
- code = krb5_get_server_rcache(context, &cred->name->princ->data[0],
|
||||
- &rc);
|
||||
- if (code) {
|
||||
- major = GSS_S_FAILURE;
|
||||
- goto cleanup;
|
||||
+ if (rc == NULL) {
|
||||
+ /* Open the replay cache for this principal. */
|
||||
+ code = krb5_get_server_rcache(context, &cred->name->princ->data[0],
|
||||
+ &rc);
|
||||
+ if (code) {
|
||||
+ major = GSS_S_FAILURE;
|
||||
+ goto cleanup;
|
||||
+ }
|
||||
}
|
||||
} else {
|
||||
/* Make sure we have a keytab with keys in it. */
|
||||
@@ -718,8 +735,8 @@ acquire_cred_context(krb5_context context, OM_uint32 *minor_status,
|
||||
gss_name_t desired_name, gss_buffer_t password,
|
||||
OM_uint32 time_req, gss_cred_usage_t cred_usage,
|
||||
krb5_ccache ccache, krb5_keytab client_keytab,
|
||||
- krb5_keytab keytab, krb5_boolean iakerb,
|
||||
- gss_cred_id_t *output_cred_handle,
|
||||
+ krb5_keytab keytab, const char *rcname,
|
||||
+ krb5_boolean iakerb, gss_cred_id_t *output_cred_handle,
|
||||
OM_uint32 *time_rec)
|
||||
{
|
||||
krb5_gss_cred_id_t cred = NULL;
|
||||
@@ -775,7 +792,7 @@ acquire_cred_context(krb5_context context, OM_uint32 *minor_status,
|
||||
* in cred->name if desired_princ is specified.
|
||||
*/
|
||||
if (cred_usage == GSS_C_ACCEPT || cred_usage == GSS_C_BOTH) {
|
||||
- ret = acquire_accept_cred(context, minor_status, keytab, cred);
|
||||
+ ret = acquire_accept_cred(context, minor_status, keytab, rcname, cred);
|
||||
if (ret != GSS_S_COMPLETE)
|
||||
goto error_out;
|
||||
}
|
||||
@@ -867,7 +884,7 @@ acquire_cred(OM_uint32 *minor_status, gss_name_t desired_name,
|
||||
|
||||
ret = acquire_cred_context(context, minor_status, desired_name, password,
|
||||
time_req, cred_usage, ccache, NULL, keytab,
|
||||
- iakerb, output_cred_handle, time_rec);
|
||||
+ NULL, iakerb, output_cred_handle, time_rec);
|
||||
|
||||
out:
|
||||
krb5_free_context(context);
|
||||
@@ -1135,7 +1152,7 @@ krb5_gss_acquire_cred_from(OM_uint32 *minor_status,
|
||||
krb5_keytab client_keytab = NULL;
|
||||
krb5_keytab keytab = NULL;
|
||||
krb5_ccache ccache = NULL;
|
||||
- const char *value;
|
||||
+ const char *rcname, *value;
|
||||
OM_uint32 ret;
|
||||
|
||||
code = gss_krb5int_initialize_library();
|
||||
@@ -1191,9 +1208,14 @@ krb5_gss_acquire_cred_from(OM_uint32 *minor_status,
|
||||
}
|
||||
}
|
||||
|
||||
+ ret = kg_value_from_cred_store(cred_store, KRB5_CS_RCACHE_URN, &rcname);
|
||||
+ if (GSS_ERROR(ret))
|
||||
+ goto out;
|
||||
+
|
||||
ret = acquire_cred_context(context, minor_status, desired_name, NULL,
|
||||
time_req, cred_usage, ccache, client_keytab,
|
||||
- keytab, 0, output_cred_handle, time_rec);
|
||||
+ keytab, rcname, 0, output_cred_handle,
|
||||
+ time_rec);
|
||||
|
||||
out:
|
||||
if (ccache != NULL)
|
||||
diff --git a/src/lib/gssapi/krb5/gssapiP_krb5.h b/src/lib/gssapi/krb5/gssapiP_krb5.h
|
||||
index 0167816..8e4f6d9 100644
|
||||
--- a/src/lib/gssapi/krb5/gssapiP_krb5.h
|
||||
+++ b/src/lib/gssapi/krb5/gssapiP_krb5.h
|
||||
@@ -1260,6 +1260,7 @@ data_to_gss(krb5_data *input_k5data, gss_buffer_t output_buffer)
|
||||
#define KRB5_CS_CLI_KEYTAB_URN "client_keytab"
|
||||
#define KRB5_CS_KEYTAB_URN "keytab"
|
||||
#define KRB5_CS_CCACHE_URN "ccache"
|
||||
+#define KRB5_CS_RCACHE_URN "rcache"
|
||||
|
||||
OM_uint32
|
||||
kg_value_from_cred_store(gss_const_key_value_set_t cred_store,
|
||||
@ -1,82 +0,0 @@
|
||||
commit 6f8d5135334c9ddb674f9824e750872b3b0642ea
|
||||
Author: Greg Hudson <ghudson@mit.edu>
|
||||
Date: Thu Jan 16 11:49:55 2014 -0500
|
||||
|
||||
Add test for gss_acquire_cred_from rcache feature
|
||||
|
||||
diff --git a/src/tests/gssapi/t_credstore.c b/src/tests/gssapi/t_credstore.c
|
||||
index 575f96d..e28f5d0 100644
|
||||
--- a/src/tests/gssapi/t_credstore.c
|
||||
+++ b/src/tests/gssapi/t_credstore.c
|
||||
@@ -46,7 +46,9 @@ main(int argc, char *argv[])
|
||||
gss_cred_usage_t cred_usage = GSS_C_BOTH;
|
||||
gss_OID_set mechs = GSS_C_NO_OID_SET;
|
||||
gss_cred_id_t cred = GSS_C_NO_CREDENTIAL;
|
||||
- krb5_boolean store_creds = FALSE;
|
||||
+ gss_ctx_id_t ictx = GSS_C_NO_CONTEXT, actx = GSS_C_NO_CONTEXT;
|
||||
+ gss_buffer_desc itok, atok;
|
||||
+ krb5_boolean store_creds = FALSE, replay = FALSE;
|
||||
char opt;
|
||||
|
||||
/* Parse options. */
|
||||
@@ -54,6 +56,8 @@ main(int argc, char *argv[])
|
||||
opt = (*argv)[1];
|
||||
if (opt == 's')
|
||||
store_creds = TRUE;
|
||||
+ else if (opt == 'r')
|
||||
+ replay = TRUE;
|
||||
else if (opt == 'a')
|
||||
cred_usage = GSS_C_ACCEPT;
|
||||
else if (opt == 'b')
|
||||
@@ -101,6 +105,31 @@ main(int argc, char *argv[])
|
||||
&store, &cred, NULL, NULL);
|
||||
check_gsserr("gss_acquire_cred_from", major, minor);
|
||||
|
||||
+ if (replay) {
|
||||
+ /* Induce a replay using cred as the acceptor cred, to test the replay
|
||||
+ * cache indicated by the store. */
|
||||
+ major = gss_init_sec_context(&minor, GSS_C_NO_CREDENTIAL, &ictx, name,
|
||||
+ &mech_krb5, 0, GSS_C_INDEFINITE,
|
||||
+ GSS_C_NO_CHANNEL_BINDINGS,
|
||||
+ GSS_C_NO_BUFFER, NULL, &itok, NULL, NULL);
|
||||
+ check_gsserr("gss_init_sec_context", major, minor);
|
||||
+ (void)gss_delete_sec_context(&minor, &ictx, NULL);
|
||||
+
|
||||
+ major = gss_accept_sec_context(&minor, &actx, cred, &itok,
|
||||
+ GSS_C_NO_CHANNEL_BINDINGS, NULL, NULL,
|
||||
+ &atok, NULL, NULL, NULL);
|
||||
+ check_gsserr("gss_accept_sec_context(1)", major, minor);
|
||||
+ (void)gss_release_buffer(&minor, &atok);
|
||||
+ (void)gss_delete_sec_context(&minor, &actx, NULL);
|
||||
+
|
||||
+ major = gss_accept_sec_context(&minor, &actx, cred, &itok,
|
||||
+ GSS_C_NO_CHANNEL_BINDINGS, NULL, NULL,
|
||||
+ &atok, NULL, NULL, NULL);
|
||||
+ check_gsserr("gss_accept_sec_context(2)", major, minor);
|
||||
+ (void)gss_release_buffer(&minor, &atok);
|
||||
+ (void)gss_delete_sec_context(&minor, &actx, NULL);
|
||||
+ }
|
||||
+
|
||||
gss_release_name(&minor, &name);
|
||||
gss_release_cred(&minor, &cred);
|
||||
free(store.elements);
|
||||
diff --git a/src/tests/gssapi/t_gssapi.py b/src/tests/gssapi/t_gssapi.py
|
||||
index 74139e4..106910d 100755
|
||||
--- a/src/tests/gssapi/t_gssapi.py
|
||||
+++ b/src/tests/gssapi/t_gssapi.py
|
||||
@@ -91,6 +91,15 @@ realm.kinit(service_cs, None, ['-k', '-t', servicekeytab])
|
||||
realm.run(['./t_credstore', '-s', 'p:' + service_cs, 'ccache', storagecache,
|
||||
'keytab', servicekeytab])
|
||||
|
||||
+# Test rcache feature of cred stores. t_credstore -r should produce a
|
||||
+# replay error normally, but not with rcache set to "none:".
|
||||
+output = realm.run(['./t_credstore', '-r', '-a', 'p:' + realm.host_princ],
|
||||
+ expected_code=1)
|
||||
+if 'gss_accept_sec_context(2): Request is a replay' not in output:
|
||||
+ fail('Expected replay error not seen in t_credstore output')
|
||||
+realm.run(['./t_credstore', '-r', '-a', 'p:' + realm.host_princ,
|
||||
+ 'rcache', 'none:'])
|
||||
+
|
||||
# Verify that we can't acquire acceptor creds without a keytab.
|
||||
os.remove(realm.keytab)
|
||||
output = realm.run(['./t_accname', 'p:abc'], expected_code=1)
|
||||
@ -1,46 +0,0 @@
|
||||
commit 74ff6c4accb68bd1d6c652c55e66519720db9fc4
|
||||
Author: Greg Hudson <ghudson@mit.edu>
|
||||
Date: Wed Jan 15 12:31:41 2014 -0500
|
||||
|
||||
Make rcache resolve functions take const char *
|
||||
|
||||
diff --git a/src/include/k5-int.h b/src/include/k5-int.h
|
||||
index bbc7fab..b4757a9 100644
|
||||
--- a/src/include/k5-int.h
|
||||
+++ b/src/include/k5-int.h
|
||||
@@ -1887,8 +1887,10 @@ krb5_error_code KRB5_CALLCONV
|
||||
krb5int_cc_user_set_default_name(krb5_context context, const char *name);
|
||||
|
||||
krb5_error_code krb5_rc_default(krb5_context, krb5_rcache *);
|
||||
-krb5_error_code krb5_rc_resolve_type(krb5_context, krb5_rcache *,char *);
|
||||
-krb5_error_code krb5_rc_resolve_full(krb5_context, krb5_rcache *,char *);
|
||||
+krb5_error_code krb5_rc_resolve_type(krb5_context, krb5_rcache *,
|
||||
+ const char *);
|
||||
+krb5_error_code krb5_rc_resolve_full(krb5_context, krb5_rcache *,
|
||||
+ const char *);
|
||||
char *krb5_rc_get_type(krb5_context, krb5_rcache);
|
||||
char *krb5_rc_default_type(krb5_context);
|
||||
char *krb5_rc_default_name(krb5_context);
|
||||
diff --git a/src/lib/krb5/rcache/rc_base.c b/src/lib/krb5/rcache/rc_base.c
|
||||
index 2fc96c5..373ac30 100644
|
||||
--- a/src/lib/krb5/rcache/rc_base.c
|
||||
+++ b/src/lib/krb5/rcache/rc_base.c
|
||||
@@ -65,7 +65,8 @@ krb5_rc_register_type(krb5_context context, const krb5_rc_ops *ops)
|
||||
}
|
||||
|
||||
krb5_error_code
|
||||
-krb5_rc_resolve_type(krb5_context context, krb5_rcache *idptr, char *type)
|
||||
+krb5_rc_resolve_type(krb5_context context, krb5_rcache *idptr,
|
||||
+ const char *type)
|
||||
{
|
||||
struct krb5_rc_typelist *t;
|
||||
krb5_error_code err;
|
||||
@@ -146,7 +147,7 @@ krb5_rc_default(krb5_context context, krb5_rcache *idptr)
|
||||
|
||||
krb5_error_code
|
||||
krb5_rc_resolve_full(krb5_context context, krb5_rcache *idptr,
|
||||
- char *string_name)
|
||||
+ const char *string_name)
|
||||
{
|
||||
char *type;
|
||||
char *residual;
|
||||
@ -1,23 +0,0 @@
|
||||
commit b6810da129512b6d0200580d78d22d38cc214e21
|
||||
Author: Lukas Slebodnik <lslebodn@redhat.com>
|
||||
Date: Sat Jun 21 17:09:31 2014 +0200
|
||||
|
||||
Fix error check in krb5_ldap_parse_principal_name
|
||||
|
||||
Test the correct variable for NULL to detect a strdup failure.
|
||||
|
||||
[ghudson@mit.edu: clarified commit message]
|
||||
|
||||
diff --git a/src/plugins/kdb/ldap/libkdb_ldap/ldap_principal.c b/src/plugins/kdb/ldap/libkdb_ldap/ldap_principal.c
|
||||
index 21695a9..44bf339 100644
|
||||
--- a/src/plugins/kdb/ldap/libkdb_ldap/ldap_principal.c
|
||||
+++ b/src/plugins/kdb/ldap/libkdb_ldap/ldap_principal.c
|
||||
@@ -412,7 +412,7 @@ krb5_ldap_parse_principal_name(char *i_princ_name, char **o_princ_name)
|
||||
at_rlm_name = strrchr(i_princ_name, '@');
|
||||
if (!at_rlm_name) {
|
||||
*o_princ_name = strdup(i_princ_name);
|
||||
- if (!o_princ_name)
|
||||
+ if (!*o_princ_name)
|
||||
return ENOMEM;
|
||||
} else {
|
||||
k5_buf_init_dynamic(&buf);
|
||||
94
krb5.spec
94
krb5.spec
@ -37,19 +37,20 @@
|
||||
%global configure_default_ccache_name 1
|
||||
%global configured_default_ccache_name KEYRING:persistent:%%{uid}
|
||||
%endif
|
||||
%global prerelease -alpha1
|
||||
|
||||
Summary: The Kerberos network authentication system
|
||||
Name: krb5
|
||||
Version: 1.12.2
|
||||
Release: 3%{?dist}
|
||||
Version: 1.13
|
||||
Release: 0%{?dist}.alpha1.1
|
||||
# Maybe we should explode from the now-available-to-everybody tarball instead?
|
||||
# http://web.mit.edu/kerberos/dist/krb5/1.12/krb5-1.12.2-signed.tar
|
||||
Source0: krb5-%{version}.tar.gz
|
||||
Source1: krb5-%{version}.tar.gz.asc
|
||||
# http://web.mit.edu/kerberos/dist/krb5/1.13/krb5-1.13-alpha1-signed.tar
|
||||
Source0: krb5-%{version}%{prerelease}.tar.gz
|
||||
Source1: krb5-%{version}%{prerelease}.tar.gz.asc
|
||||
# Use a dummy krb5-%{version}-pdf.tar.xz the first time through, then
|
||||
# tar cvJf $RPM_SOURCE_DIR/krb5-%%{version}-pdf.tar.xz build-pdf/*.pdf
|
||||
# after the build phase finishes.
|
||||
Source3: krb5-%{version}-pdf.tar.xz
|
||||
Source3: krb5-%{version}%{prerelease}-pdf.tar.xz
|
||||
Source2: kprop.service
|
||||
Source4: kadmin.service
|
||||
Source5: krb5kdc.service
|
||||
@ -76,36 +77,18 @@ Source100: nss_wrapper-0.0-20140204195100.git3d58327.tar.xz
|
||||
Source101: noport.c
|
||||
Source102: socket_wrapper-0.0-20140204194748.gitf3b2ece.tar.xz
|
||||
|
||||
Patch1: krb5-1.12-pwdch-fast.patch
|
||||
Patch6: krb5-1.12-ksu-path.patch
|
||||
Patch12: krb5-1.12-ktany.patch
|
||||
Patch16: krb5-1.12-buildconf.patch
|
||||
Patch23: krb5-1.3.1-dns.patch
|
||||
Patch29: krb5-1.10-kprop-mktemp.patch
|
||||
Patch30: krb5-1.3.4-send-pr-tempfile.patch
|
||||
Patch39: krb5-1.12-api.patch
|
||||
Patch59: krb5-1.10-kpasswd_tcp.patch
|
||||
Patch60: krb5-1.12.1-pam.patch
|
||||
Patch63: krb5-1.12-selinux-label.patch
|
||||
Patch71: krb5-1.11-dirsrv-accountlock.patch
|
||||
Patch63: krb5-1.13-selinux-label.patch
|
||||
Patch71: krb5-1.13-dirsrv-accountlock.patch
|
||||
Patch86: krb5-1.9-debuginfo.patch
|
||||
Patch105: krb5-kvno-230379.patch
|
||||
Patch129: krb5-1.11-run_user_0.patch
|
||||
Patch134: krb5-1.11-kpasswdtest.patch
|
||||
Patch136: krb5-master-rcache-internal-const.patch
|
||||
Patch137: krb5-master-rcache-acquirecred-cleanup.patch
|
||||
Patch139: krb5-master-rcache-acquirecred-source.patch
|
||||
Patch141: krb5-master-rcache-acquirecred-test.patch
|
||||
Patch142: krb5-master-move-otp-sockets.patch
|
||||
Patch145: krb5-master-mechd.patch
|
||||
Patch146: krb5-master-strdupcheck.patch
|
||||
Patch201: 0001-In-ksu-merge-krb5_ccache_copy-and-_restricted.patch
|
||||
Patch202: 0002-In-ksu-don-t-stat-not-on-disk-ccache-residuals.patch
|
||||
Patch203: 0003-Use-an-intermediate-memory-cache-in-ksu.patch
|
||||
Patch204: 0004-Make-ksu-respect-the-default_ccache_name-setting.patch
|
||||
Patch205: 0005-Copy-config-entries-to-the-ksu-target-ccache.patch
|
||||
Patch206: 0006-Use-more-randomness-for-ksu-secondary-cache-names.patch
|
||||
Patch207: 0007-Make-krb5_cc_new_unique-create-DIR-directories.patch
|
||||
|
||||
License: MIT
|
||||
URL: http://web.mit.edu/kerberos/www/
|
||||
@ -238,8 +221,6 @@ Requires: chkconfig
|
||||
# we drop files in its directory, but we don't want to own that directory
|
||||
Requires: logrotate
|
||||
Requires(preun): initscripts
|
||||
# mktemp is used by krb5-send-pr
|
||||
Requires: coreutils
|
||||
# we specify /usr/share/dict/words as the default dict_file in kdc.conf
|
||||
Requires: /usr/share/dict/words
|
||||
%if %{WITH_SYSVERTO}
|
||||
@ -272,8 +253,6 @@ realm, you need to install this package.
|
||||
Summary: Kerberos 5 programs for use on workstations
|
||||
Group: System Environment/Base
|
||||
Requires: %{name}-libs%{?_isa} = %{version}-%{release}
|
||||
# mktemp is used by krb5-send-pr
|
||||
Requires: coreutils
|
||||
|
||||
%description workstation
|
||||
Kerberos is a network authentication system. The krb5-workstation
|
||||
@ -305,19 +284,9 @@ to obtain initial credentials from a KDC using a private key and a
|
||||
certificate.
|
||||
|
||||
%prep
|
||||
%setup -q -a 3 -a 100 -a 102
|
||||
%setup -q -n %{name}-%{version}%{prerelease} -a 3 -a 100 -a 102
|
||||
ln -s NOTICE LICENSE
|
||||
|
||||
%patch201 -p1 -b .In-ksu-merge-krb5_ccache_copy-and-_restricted
|
||||
%patch202 -p1 -b .In-ksu-don-t-stat-not-on-disk-ccache-residuals
|
||||
%patch203 -p1 -b .Use-an-intermediate-memory-cache-in-ksu
|
||||
%patch204 -p1 -b .Make-ksu-respect-the-default_ccache_name-setting
|
||||
%patch205 -p1 -b .Copy-config-entries-to-the-ksu-target-ccache
|
||||
%patch206 -p1 -b .Use-more-randomness-for-ksu-secondary-cache-names
|
||||
%patch207 -p1 -b .Make-krb5_cc_new_unique-create-DIR-directories
|
||||
|
||||
%patch1 -p1 -b .pwdch-fast
|
||||
|
||||
%patch60 -p1 -b .pam
|
||||
|
||||
%patch63 -p1 -b .selinux-label
|
||||
@ -326,10 +295,7 @@ ln -s NOTICE LICENSE
|
||||
%patch12 -p1 -b .ktany
|
||||
%patch16 -p1 -b .buildconf %{?_rawbuild}
|
||||
%patch23 -p1 -b .dns %{?_rawbuild}
|
||||
%patch29 -p1 -b .kprop-mktemp
|
||||
%patch30 -p1 -b .send-pr-tempfile
|
||||
%patch39 -p1 -b .api
|
||||
%patch59 -p1 -b .kpasswd_tcp
|
||||
%patch71 -p1 -b .dirsrv-accountlock %{?_rawbuild}
|
||||
%patch86 -p0 -b .debuginfo
|
||||
%patch105 -p1 -b .kvno
|
||||
@ -340,14 +306,6 @@ ln -s NOTICE LICENSE
|
||||
|
||||
%patch134 -p1 -b .kpasswdtest
|
||||
|
||||
%patch136 -p1 -b .rcache-internal-const
|
||||
%patch137 -p1 -b .rcache-acquirecred-cleanup
|
||||
%patch139 -p1 -b .rcache-acquirecred-source
|
||||
%patch141 -p1 -b .rcache-acquirecred-test
|
||||
%patch142 -p1 -b .move-otp-sockets
|
||||
%patch145 -p1 -b .master-mechd
|
||||
%patch146 -p1 -b .master-strdupcheck
|
||||
|
||||
# Take the execute bit off of documentation.
|
||||
chmod -x doc/krb5-protocol/*.txt doc/ccapi/*.html
|
||||
|
||||
@ -364,8 +322,6 @@ touch -r $inldif 60kerberos.ldif
|
||||
|
||||
# Rebuild the configure scripts.
|
||||
pushd src
|
||||
#autoheader
|
||||
#autoconf
|
||||
./util/reconf --verbose
|
||||
popd
|
||||
|
||||
@ -378,9 +334,7 @@ mkdir -p socket_wrapper/build
|
||||
cfg="src/kadmin/testing/proto/kdc.conf.proto \
|
||||
src/kadmin/testing/proto/krb5.conf.proto \
|
||||
src/lib/kadm5/unit-test/api.current/init-v2.exp \
|
||||
src/util/k5test.py \
|
||||
src/tests/mk_migr/ldap_backend/input_conf/*.conf \
|
||||
src/tests/mk_migr/db2_backend/input_conf/*.conf"
|
||||
src/util/k5test.py"
|
||||
LONG_BIT=`getconf LONG_BIT`
|
||||
PORT=`expr 61000 + $LONG_BIT - 48`
|
||||
sed -i -e s,61000,`expr "$PORT" + 0`,g $cfg
|
||||
@ -442,9 +396,11 @@ CPPFLAGS="`echo $DEFINES $INCLUDES`"
|
||||
%endif
|
||||
%if %{WITH_OPENSSL}
|
||||
--with-pkinit-crypto-impl=openssl \
|
||||
--with-tls-impl=openssl \
|
||||
%endif
|
||||
%if %{WITH_NSS}
|
||||
--with-crypto-impl=nss \
|
||||
--without-tls-impl \
|
||||
%endif
|
||||
%if %{WITH_SYSVERTO}
|
||||
--with-system-verto \
|
||||
@ -656,6 +612,10 @@ for section in 1 5 8 ; do
|
||||
$RPM_BUILD_ROOT/%{_mandir}/man${section}/
|
||||
done
|
||||
|
||||
# This script just tells you to send bug reports to krb5-bugs@mit.edu, but
|
||||
# since we don't have a man page for it, just drop it.
|
||||
rm $RPM_BUILD_ROOT/%{_sbindir}/krb5-send-pr
|
||||
|
||||
%find_lang %{gettext_domain}
|
||||
|
||||
%clean
|
||||
@ -831,12 +791,6 @@ exit 0
|
||||
%{_mandir}/man1/ksu.1*
|
||||
%config(noreplace) /etc/pam.d/ksu
|
||||
|
||||
# Problem-reporting tool.
|
||||
%{_sbindir}/krb5-send-pr
|
||||
%dir %{_datadir}/gnats
|
||||
%{_datadir}/gnats/mit
|
||||
%{_mandir}/man1/krb5-send-pr.1*
|
||||
|
||||
%files server
|
||||
%defattr(-,root,root,-)
|
||||
%docdir %{_mandir}
|
||||
@ -871,13 +825,6 @@ exit 0
|
||||
%dir %{_libdir}/krb5/plugins/authdata
|
||||
%{_libdir}/krb5/plugins/preauth/otp.so
|
||||
|
||||
|
||||
# Problem-reporting tool.
|
||||
%{_sbindir}/krb5-send-pr
|
||||
%dir %{_datadir}/gnats
|
||||
%{_datadir}/gnats/mit
|
||||
%{_mandir}/man1/krb5-send-pr.1*
|
||||
|
||||
# KDC binaries and configuration.
|
||||
%{_mandir}/man5/kadm5.acl.5*
|
||||
%{_mandir}/man5/kdc.conf.5*
|
||||
@ -961,6 +908,9 @@ exit 0
|
||||
%dir %{_libdir}/krb5/plugins
|
||||
%dir %{_libdir}/krb5/plugins/*
|
||||
%{_libdir}/krb5/plugins/kdb/db2.so
|
||||
%if %{WITH_OPENSSL}
|
||||
%{_libdir}/krb5/plugins/tls/k5tls.so
|
||||
%endif
|
||||
%dir %{_var}/kerberos
|
||||
%dir %{_var}/kerberos/krb5
|
||||
%dir %{_var}/kerberos/krb5/user
|
||||
@ -1023,6 +973,10 @@ exit 0
|
||||
%{_sbindir}/uuserver
|
||||
|
||||
%changelog
|
||||
* Fri Aug 22 2014 Nalin Dahyabhai <nalin@redhat.com> - 1.12.2-4
|
||||
- update to 1.13 alpha1
|
||||
- drop upstreamed and backported patches
|
||||
|
||||
* Wed Aug 20 2014 Nalin Dahyabhai <nalin@redhat.com> - 1.12.2-3
|
||||
- pull in upstream fix for an incorrect check on the value returned by a
|
||||
strdup() call (#1132062)
|
||||
|
||||
6
sources
6
sources
@ -1,5 +1,5 @@
|
||||
8777a835ae84f7d2f5872bf388bc6d76 krb5-1.12.2.tar.gz
|
||||
5a45834367bda0a037d1b8f5a8912002 krb5-1.12.2.tar.gz.asc
|
||||
c4dca109bc4d480ae4b05d1430671c77 krb5-1.12.2-pdf.tar.xz
|
||||
c0b597b78cd13be105aff29c600883b9 krb5-1.13-alpha1.tar.gz
|
||||
49a891e6007a42a7e6f82e5943899a2c krb5-1.13-alpha1.tar.gz.asc
|
||||
d3c480887984f14ecd8d93fd30a11896 krb5-1.13-alpha1-pdf.tar.xz
|
||||
142c7f3f8d2b08936d2cee3de743133e nss_wrapper-0.0-20140204195100.git3d58327.tar.xz
|
||||
d8e42cf537192765463c3f1bad870250 socket_wrapper-0.0-20140204194748.gitf3b2ece.tar.xz
|
||||
|
||||
Loading…
Reference in New Issue
Block a user